Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Lanolin, Thermo Scientific Chemicals
CAS: 8006-54-0 MDL Number: MFCD00081740 Synonym: dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer
| CAS | 8006-54-0 |
|---|---|
| MDL Number | MFCD00081740 |
| Synonym | dmt-2'o-tbdms-rc ac phosphoramidite,dmt-2'o-tbdms-rc ac phosphoramidite, configured for abi,dmt-2'o-tbdms-rc ac phosphoramidite, configured for mermade,ac-c-ce phosphoramidite,dmt-2'o-tbdms-rc ac amidite,dmt-2'o-tbdms-rc ac pharmadite r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for ??kta r and oligopilot r,dmt-2'o-tbdms-rc ac phosphoramidite, configured for perkinelmer, configured for polygen,dmt-2'o-tbdms-rc ac phosphoramidite, configured for polygen, configured for perkinelmer |
Uric acid, 99%, Thermo Scientific Chemicals
CAS: 69-93-2 Molecular Formula: C5H4N4O3 Molecular Weight (g/mol): 168.112 MDL Number: MFCD00005712 InChI Key: LEHOTFFKMJEONL-UHFFFAOYSA-N Synonym: uric acid,urate,2,6,8-trioxypurine,lithic acid,2,6,8-trihydroxypurine,2,6,8-trioxopurine,1h-purine-2,6,8-triol,8-hydroxyxanthine,7,9-dihydro-1h-purine-2,6,8 3h-trione,1h-purine-2,6,8 3h-trione, 7,9-dihydro PubChem CID: 1175 ChEBI: CHEBI:17775 IUPAC Name: 7,9-dihydro-3H-purine-2,6,8-trione SMILES: C12=C(NC(=O)N1)NC(=O)NC2=O
| PubChem CID | 1175 |
|---|---|
| CAS | 69-93-2 |
| Molecular Weight (g/mol) | 168.112 |
| ChEBI | CHEBI:17775 |
| MDL Number | MFCD00005712 |
| SMILES | C12=C(NC(=O)N1)NC(=O)NC2=O |
| Synonym | uric acid,urate,2,6,8-trioxypurine,lithic acid,2,6,8-trihydroxypurine,2,6,8-trioxopurine,1h-purine-2,6,8-triol,8-hydroxyxanthine,7,9-dihydro-1h-purine-2,6,8 3h-trione,1h-purine-2,6,8 3h-trione, 7,9-dihydro |
| IUPAC Name | 7,9-dihydro-3H-purine-2,6,8-trione |
| InChI Key | LEHOTFFKMJEONL-UHFFFAOYSA-N |
| Molecular Formula | C5H4N4O3 |
| Molecular Weight (g/mol) | 397.63 |
|---|---|
| Color | White |
| Physical Form | Crystalline Powder |
| Chemical Name or Material | Sucralose |
| Merck Index | XIII 8965 |
| Specific Rotation Condition | (20°C, 589 nm) (c=1% aq. soln.) |
| CAS | 56038-13-2 |
| Infrared Spectrum | Conforms |
| MDL Number | 03648615 |
| Specific Rotation | 84° to 88° |
| Packaging | Plastic bottle |
| Alpha Vector | SUCRALOSE |
| Synonym | Trichlorosucrose |
| RTECS Number | LW5440140 |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C12 H19 Cl3 O8 |
| EINECS Number | 259-952-2 |
| Melting Point | 130°C |
Oleyl alcohol, tech. 80-85%, Thermo Scientific Chemicals
CAS: 143-28-2 Molecular Formula: C18H36O Molecular Weight (g/mol): 268.49 MDL Number: MFCD00002993 InChI Key: ALSTYHKOOCGGFT-KTKRTIGZSA-N Synonym: oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol PubChem CID: 5284499 ChEBI: CHEBI:73504 IUPAC Name: (9Z)-octadec-9-en-1-ol SMILES: CCCCCCCC\C=C/CCCCCCCCO
| PubChem CID | 5284499 |
|---|---|
| CAS | 143-28-2 |
| Molecular Weight (g/mol) | 268.49 |
| ChEBI | CHEBI:73504 |
| MDL Number | MFCD00002993 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCO |
| Synonym | oleyl alcohol,cis-9-octadecen-1-ol,z-octadec-9-en-1-ol,ocenol,conditioner 1,dermaffine,lancol,novol,oceol,oleol |
| IUPAC Name | (9Z)-octadec-9-en-1-ol |
| InChI Key | ALSTYHKOOCGGFT-KTKRTIGZSA-N |
| Molecular Formula | C18H36O |
| Boiling Point | 152°C to 153°C |
|---|---|
| Molecular Weight (g/mol) | 284.48 |
| Color | Colorless or White to Yellow |
| Physical Form | Liquid or Powder |
| Chemical Name or Material | Methyl heptadecanoate |
| CAS | 1731-92-6 |
| Infrared Spectrum | Conforms |
| MDL Number | 00009001 |
| Packaging | Glass bottle |
| Flash Point | >110°C |
| Alpha Vector | METHYLHEPTADECANOATE |
| Synonym | Methyl margarate |
| Recommended Storage | Normal conditions |
| Shelf Life | 5 years |
| Molecular Formula | C18 H36 O2 |
| EINECS Number | 217-055-3 |
| Melting Point | 29°C to 30°C |
1H,1H,2H-Perfluoro-1-decene, 99%, Thermo Scientific™
CAS: 21652-58-4 Molecular Formula: C10H3F17 Molecular Weight (g/mol): 446.11 MDL Number: MFCD00039246 InChI Key: NKAMGQZDVMQEJL-UHFFFAOYSA-N Synonym: 1h,1h,2h-perfluoro-1-decene,perfluoro-n-octyl ethylene,perfluorooctyl ethylene,tridecafluoro 1-decene,1h,1h,2h-perfluorodec-1-ene,1h,1h,2h-heptadecafluoro-1-decene,perfluoroctyl ethylene,cf3 cf2 7ch=ch2,1-heptadecafluorooctyl ethene PubChem CID: 88990 IUPAC Name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene SMILES: FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C
| PubChem CID | 88990 |
|---|---|
| CAS | 21652-58-4 |
| Molecular Weight (g/mol) | 446.11 |
| MDL Number | MFCD00039246 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=C |
| Synonym | 1h,1h,2h-perfluoro-1-decene,perfluoro-n-octyl ethylene,perfluorooctyl ethylene,tridecafluoro 1-decene,1h,1h,2h-perfluorodec-1-ene,1h,1h,2h-heptadecafluoro-1-decene,perfluoroctyl ethylene,cf3 cf2 7ch=ch2,1-heptadecafluorooctyl ethene |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodec-1-ene |
| InChI Key | NKAMGQZDVMQEJL-UHFFFAOYSA-N |
| Molecular Formula | C10H3F17 |
Nicotinic acid, specified according to the requirements of Ph. Eur, Thermo Scientific Chemicals
CAS: 59-67-6 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 123.11 MDL Number: MFCD00006391 InChI Key: PVNIIMVLHYAWGP-UHFFFAOYSA-N Synonym: nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil PubChem CID: 938 ChEBI: CHEBI:15940 IUPAC Name: pyridine-3-carboxylic acid SMILES: OC(=O)C1=CC=CN=C1
| PubChem CID | 938 |
|---|---|
| CAS | 59-67-6 |
| Molecular Weight (g/mol) | 123.11 |
| ChEBI | CHEBI:15940 |
| MDL Number | MFCD00006391 |
| SMILES | OC(=O)C1=CC=CN=C1 |
| Synonym | nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil |
| IUPAC Name | pyridine-3-carboxylic acid |
| InChI Key | PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO2 |
NADPH tetrasodium salt hydrate, 93%, extra pure, Thermo Scientific Chemicals
CAS: 2646-71-1 Molecular Formula: C21H26N7Na4O17P3 Molecular Weight (g/mol): 833.35 MDL Number: MFCD10567216 InChI Key: WYWWVJHQDVCHKF-NRTBITFTNA-J Synonym: nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form PubChem CID: 131673986 IUPAC Name: [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium SMILES: [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131673986 |
|---|---|
| CAS | 2646-71-1 |
| Molecular Weight (g/mol) | 833.35 |
| MDL Number | MFCD10567216 |
| SMILES | [Na+].[Na+].[Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP([O-])([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nadph tetrasodium salt,nadph, tetrasodium salt,coenzyme ii tetrasodium salt reduced form |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |
| InChI Key | WYWWVJHQDVCHKF-NRTBITFTNA-J |
| Molecular Formula | C21H26N7Na4O17P3 |
Poly(vinyl alcohol), 88% hydrolyzed, average M.W. 85,000 to 120,000, Thermo Scientific Chemicals
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Diisopropylamine, 99%, Thermo Scientific Chemicals
CAS: 108-18-9 InChI Key: UAOMVDZJSHZZME-UHFFFAOYSA-N Synonym: diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine PubChem CID: 7912 IUPAC Name: N-propan-2-ylpropan-2-amine SMILES: CC(C)NC(C)C
| PubChem CID | 7912 |
|---|---|
| CAS | 108-18-9 |
| SMILES | CC(C)NC(C)C |
| Synonym | diisopropylamine,2-propanamine, n-1-methylethyl,n-1-methylethyl-2-propanamine,dipa,n,n-diisopropylamine,bis propan-2-yl amine,n-isopropylpropan-2-amine,di-isopropylamine,n-isopropyl-1-amino-2-methylethane,diisopropyl amine |
| IUPAC Name | N-propan-2-ylpropan-2-amine |
| InChI Key | UAOMVDZJSHZZME-UHFFFAOYSA-N |
Acetylsalicylic acid, 99%, Thermo Scientific Chemicals
CAS: 50-78-2 Molecular Formula: C9H8O4 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00002430 InChI Key: BSYNRYMUTXBXSQ-UHFFFAOYSA-N Synonym: aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin PubChem CID: 2244 ChEBI: CHEBI:15365 IUPAC Name: 2-acetyloxybenzoic acid SMILES: CC(=O)OC1=CC=CC=C1C(O)=O
| PubChem CID | 2244 |
|---|---|
| CAS | 50-78-2 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:15365 |
| MDL Number | MFCD00002430 |
| SMILES | CC(=O)OC1=CC=CC=C1C(O)=O |
| Synonym | aspirin,acetylsalicylic acid,2-acetoxybenzoic acid,2-acetyloxy benzoic acid,acetylsalicylate,o-acetylsalicylic acid,o-acetoxybenzoic acid,acylpyrin,polopiryna,easprin |
| IUPAC Name | 2-acetyloxybenzoic acid |
| InChI Key | BSYNRYMUTXBXSQ-UHFFFAOYSA-N |
| Molecular Formula | C9H8O4 |
tert-Butyllithium, 1.9M solution in pentane, AcroSeal™, Thermo Scientific Chemicals
CAS: 594-19-4 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00008795 InChI Key: BKDLGMUIXWPYGD-UHFFFAOYSA-N Synonym: tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn PubChem CID: 638178 SMILES: [Li]C(C)(C)C
| PubChem CID | 638178 |
|---|---|
| CAS | 594-19-4 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00008795 |
| SMILES | [Li]C(C)(C)C |
| Synonym | tert-butyllithium,t-butyllithium,tbuli,lithium, 1,1-dimethylethyl,t-buli,lithium 2-methylpropane,tert-butyllithium solution,tert butyllithium,t-butyllithiurn |
| InChI Key | BKDLGMUIXWPYGD-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Diethylamine, 99+%, extra pure, Thermo Scientific Chemicals
CAS: 109-89-7 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.14 MDL Number: MFCD00009032 InChI Key: HPNMFZURTQLUMO-UHFFFAOYSA-N Synonym: diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine PubChem CID: 8021 ChEBI: CHEBI:85259 SMILES: CCNCC
| PubChem CID | 8021 |
|---|---|
| CAS | 109-89-7 |
| Molecular Weight (g/mol) | 73.14 |
| ChEBI | CHEBI:85259 |
| MDL Number | MFCD00009032 |
| SMILES | CCNCC |
| Synonym | diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine |
| InChI Key | HPNMFZURTQLUMO-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |
2-Ethoxyethanol, 99%, Thermo Scientific Chemicals
CAS: 110-80-5 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.12 MDL Number: MFCD00002869 InChI Key: ZNQVEEAIQZEUHB-UHFFFAOYSA-N Synonym: cellosolve,oxitol,ethyl cellosolve,ethylene glycol monoethyl ether,ethanol, 2-ethoxy,ethyl glycol,emkanol,hydroxy ether,ethylene glycol ethyl ether,dowanol ee PubChem CID: 8076 ChEBI: CHEBI:46788 IUPAC Name: 2-ethoxyethan-1-ol SMILES: CCOCCO
| PubChem CID | 8076 |
|---|---|
| CAS | 110-80-5 |
| Molecular Weight (g/mol) | 90.12 |
| ChEBI | CHEBI:46788 |
| MDL Number | MFCD00002869 |
| SMILES | CCOCCO |
| Synonym | cellosolve,oxitol,ethyl cellosolve,ethylene glycol monoethyl ether,ethanol, 2-ethoxy,ethyl glycol,emkanol,hydroxy ether,ethylene glycol ethyl ether,dowanol ee |
| IUPAC Name | 2-ethoxyethan-1-ol |
| InChI Key | ZNQVEEAIQZEUHB-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
Diethylamine, 99+%, Thermo Scientific Chemicals
CAS: 109-89-7 Molecular Formula: C4H11N Molecular Weight (g/mol): 73.14 MDL Number: MFCD00009032 InChI Key: HPNMFZURTQLUMO-UHFFFAOYSA-N Synonym: diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine PubChem CID: 8021 ChEBI: CHEBI:85259 SMILES: CCNCC
| PubChem CID | 8021 |
|---|---|
| CAS | 109-89-7 |
| Molecular Weight (g/mol) | 73.14 |
| ChEBI | CHEBI:85259 |
| MDL Number | MFCD00009032 |
| SMILES | CCNCC |
| Synonym | diethylamine,n,n-diethylamine,ethanamine, n-ethyl,diethamine,diaethylamin,dwuetyloamina,dietilamina,diethylamin,diethyl amine,n-ethyl-ethanamine |
| InChI Key | HPNMFZURTQLUMO-UHFFFAOYSA-N |
| Molecular Formula | C4H11N |