Learn More
Kanamycin disulfate, 700μg/mg, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66856.06
| Quantity | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 64013-70-3 | |
| 680.647 | |
| OGTKIXVMLDAMNU-KNQICTBBSA-N | |
| 24721551 | |
| C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O.OS(=O)(=O)O |
| C18H40N4O19S2 | |
| MFCD00143916 | |
| Kanamycin A; Kanamycin acid sulfate | |
| (2R,3S,4S,5R,6R)-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxane-3,4,5-triol;sulfuric acid |
Specifications
| 64013-70-3 | |
| 5g | |
| C18H40N4O19S2 | |
| Kanamycin A; Kanamycin acid sulfate | |
| OGTKIXVMLDAMNU-KNQICTBBSA-N | |
| (2R,3S,4S,5R,6R)-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxane-3,4,5-triol;sulfuric acid | |
| 24721551 | |
| Kanamycin disulfate, 700μg/mg |
| Colorless | |
| Light and moisture sensitive | |
| MFCD00143916 | |
| Soluble in aqueous solutions | |
| C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O.OS(=O)(=O)O | |
| 680.647 | |
| 680.65 |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.