Filtered Search Results
Diethylenetriaminepentaacetic acid, 98+%
CAS: 67-43-6 Molecular Formula: C14H23N3O10 Molecular Weight (g/mol): 393.34 InChI Key: QPCDCPDFJACHGM-UHFFFAOYSA-N Synonym: pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid PubChem CID: 3053 ChEBI: CHEBI:35739 IUPAC Name: 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid SMILES: C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O
| PubChem CID | 3053 |
|---|---|
| CAS | 67-43-6 |
| Molecular Weight (g/mol) | 393.34 |
| ChEBI | CHEBI:35739 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Synonym | pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| InChI Key | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| Molecular Formula | C14H23N3O10 |
Guanidine hydrochloride, 98%
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Invitrogen™ BODIPY™ 558/568 C12 (4,4-Difluoro-5-(2-Thienyl)-4-Bora-3a,4a-Diaza-s-Indacene-3-Dodecanoic Acid)
The orange-red fluorescent fatty acid, BODIPY™ 558/568 C12 can be used as a synthetic precursor to a wide variety of fluorescent phospholipids.
Gluconic acid, sodium salt, 98%
CAS: 527-07-1 Molecular Formula: C6H11NaO7 Molecular Weight (g/mol): 218.137 MDL Number: MFCD00064210 InChI Key: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC Name: sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
| PubChem CID | 23672301 |
|---|---|
| CAS | 527-07-1 |
| Molecular Weight (g/mol) | 218.137 |
| ChEBI | CHEBI:84997 |
| MDL Number | MFCD00064210 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | UPMFZISCCZSDND-JJKGCWMISA-M |
| Molecular Formula | C6H11NaO7 |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Tetrabutylammonium phosphate monobasic, 99%, HPLC grade
CAS: 5574-97-0 Molecular Formula: C16H38NO4P Molecular Weight (g/mol): 339.46 MDL Number: MFCD00064526 InChI Key: ARRNBPCNZJXHRJ-UHFFFAOYSA-M Synonym: tetrabutylammonium dihydrogen phosphate,tetrabutylammonium phosphate,tetrabutylammonium dihydrogenphosphate,1-butanaminium, n,n,n-tributyl-, phosphate 1:1,tetra-n-butylammonium phosphate,tetrabutylazanium dihydrogen phosphate,dihydrogen phosphate; tetrabutylazanium,dihydrogen phosphate; tetrabutylammonium,tetrabutyl ammonium dihydrogen phosphate,tetrabutylammonium ion dihydrogenphosphate ion PubChem CID: 2735142 IUPAC Name: dihydrogen phosphate;tetrabutylazanium SMILES: OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2735142 |
|---|---|
| CAS | 5574-97-0 |
| Molecular Weight (g/mol) | 339.46 |
| MDL Number | MFCD00064526 |
| SMILES | OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium dihydrogen phosphate,tetrabutylammonium phosphate,tetrabutylammonium dihydrogenphosphate,1-butanaminium, n,n,n-tributyl-, phosphate 1:1,tetra-n-butylammonium phosphate,tetrabutylazanium dihydrogen phosphate,dihydrogen phosphate; tetrabutylazanium,dihydrogen phosphate; tetrabutylammonium,tetrabutyl ammonium dihydrogen phosphate,tetrabutylammonium ion dihydrogenphosphate ion |
| IUPAC Name | dihydrogen phosphate;tetrabutylazanium |
| InChI Key | ARRNBPCNZJXHRJ-UHFFFAOYSA-M |
| Molecular Formula | C16H38NO4P |
Thermo Fisher Scientific DDM/CHS Solution (10:1)
A ready-to-use solution for solubilization of membrane proteins while maintaining structural integrity and activity.
Quinine monohydrochloride dihydrate, 99%
CAS: 6119-47-7 Molecular Formula: C20H29ClN2O4 Molecular Weight (g/mol): 396.91 MDL Number: MFCD00151248 InChI Key: MPQKYZPYCSTMEI-VQYSEXPNNA-N Synonym: quinine hcl dihydrate PubChem CID: 124080947 IUPAC Name: (R)-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;dihydrate;hydrochloride SMILES: O.O.Cl.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C
| PubChem CID | 124080947 |
|---|---|
| CAS | 6119-47-7 |
| Molecular Weight (g/mol) | 396.91 |
| MDL Number | MFCD00151248 |
| SMILES | O.O.Cl.[H][C@@]1(CN2CCC1C[C@@]2([H])[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1)C=C |
| Synonym | quinine hcl dihydrate |
| IUPAC Name | (R)-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;dihydrate;hydrochloride |
| InChI Key | MPQKYZPYCSTMEI-VQYSEXPNNA-N |
| Molecular Formula | C20H29ClN2O4 |
Thermo Scientific™ High-Purity Maltoside Detergents
Maltoside detergents are a class of nonionic surfactants that are commonly utilized in the field of membrane protein solubilization. Several studies have shown that these surfactants are highly effective in extracting and stabilizing membrane proteins.
Urea, ultrapure, 99%
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.056 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.056 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Guanine, 99+%
CAS: 73-40-5 Molecular Formula: C5H5N5O Molecular Weight (g/mol): 151.13 MDL Number: MFCD00071533 InChI Key: UYTPUPDQBNUYGX-UHFFFAOYSA-N Synonym: guanine,2-amino-6-hydroxypurine,guanin,2-aminohypoxanthine,mearlmaid,pearl essence,guanine enol,stella polaris,dew pearl,natural pearl essence PubChem CID: 764 ChEBI: CHEBI:16235 IUPAC Name: 2-amino-3,7-dihydropurin-6-one SMILES: NC1=NC(=O)C2=C(N1)N=CN2
| PubChem CID | 764 |
|---|---|
| CAS | 73-40-5 |
| Molecular Weight (g/mol) | 151.13 |
| ChEBI | CHEBI:16235 |
| MDL Number | MFCD00071533 |
| SMILES | NC1=NC(=O)C2=C(N1)N=CN2 |
| Synonym | guanine,2-amino-6-hydroxypurine,guanin,2-aminohypoxanthine,mearlmaid,pearl essence,guanine enol,stella polaris,dew pearl,natural pearl essence |
| IUPAC Name | 2-amino-3,7-dihydropurin-6-one |
| InChI Key | UYTPUPDQBNUYGX-UHFFFAOYSA-N |
| Molecular Formula | C5H5N5O |
1,4-Dithio-DL-threitol, Electrophoresis Grade, 99%
CAS: 12-3-3483 Molecular Formula: C4H10O2S2 Molecular Weight (g/mol): 154.24 MDL Number: MFCD00004877 InChI Key: VHJLVAABSRFDPM-IMJSIDKUSA-N Synonym: dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt PubChem CID: 446094 ChEBI: CHEBI:42170 IUPAC Name: (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol SMILES: C(C(C(CS)O)O)S
| PubChem CID | 446094 |
|---|---|
| CAS | 12-3-3483 |
| Molecular Weight (g/mol) | 154.24 |
| ChEBI | CHEBI:42170 |
| MDL Number | MFCD00004877 |
| SMILES | C(C(C(CS)O)O)S |
| Synonym | dithiothreitol,dl-1,4-dithiothreitol,dl-dithiothreitol,1,4-dithio-dl-threitol,d-1,4-dithiothreitol,d-dtt,2s,3s-1,4-dimercaptobutane-2,3-diol,threo-1,4-dimercapto-2,3-butanediol,1,4-dithiothreitol,dtt |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| InChI Key | VHJLVAABSRFDPM-IMJSIDKUSA-N |
| Molecular Formula | C4H10O2S2 |
beta-Nicotinamide adenine dinucleotide reduced disodium salt, 97%
CAS: 606-68-8 Molecular Formula: C21H27N7Na2O14P2 Molecular Weight (g/mol): 709.41 MDL Number: MFCD00036200 InChI Key: QRGNQKGQENGQSE-WUEGHLCSSA-L Synonym: beta-nadh disodium salt PubChem CID: 131673989 IUPAC Name: [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium SMILES: [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131673989 |
|---|---|
| CAS | 606-68-8 |
| Molecular Weight (g/mol) | 709.41 |
| MDL Number | MFCD00036200 |
| SMILES | [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | beta-nadh disodium salt |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |
| InChI Key | QRGNQKGQENGQSE-WUEGHLCSSA-L |
| Molecular Formula | C21H27N7Na2O14P2 |
beta-Nicotinamide adenine dinucleotide, disodium salt, hydrate, 95+%, reduced form
CAS: 1949720-50-6 Molecular Formula: C21H27N7Na2O14P2 Molecular Weight (g/mol): 709.41 MDL Number: MFCD00036200 InChI Key: QRGNQKGQENGQSE-WUEGHLCSSA-L Synonym: beta-nadh disodium salt PubChem CID: 131673989 IUPAC Name: [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium SMILES: [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131673989 |
|---|---|
| CAS | 1949720-50-6 |
| Molecular Weight (g/mol) | 709.41 |
| MDL Number | MFCD00036200 |
| SMILES | [Na+].[Na+].NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | beta-nadh disodium salt |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoyl-4H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;molecular hydrogen;sodium |
| InChI Key | QRGNQKGQENGQSE-WUEGHLCSSA-L |
| Molecular Formula | C21H27N7Na2O14P2 |