Filtered Search Results
Thermo Scientific Chemicals Phenolphthalein, 98%
CAS: 77-09-8 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00005913 InChI Key: KJFMBFZCATUALV-UHFFFAOYSA-N Synonym: phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax PubChem CID: 4764 ChEBI: CHEBI:34914 SMILES: OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1
| PubChem CID | 4764 |
|---|---|
| CAS | 77-09-8 |
| Molecular Weight (g/mol) | 318.33 |
| ChEBI | CHEBI:34914 |
| MDL Number | MFCD00005913 |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| Synonym | phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-ium chloride hydrate: 1.0%; Water: 99% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00012111 |
| Physical Form | Liquid |
| Solubility Information | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Chemical Name or Material | Methylene Blue |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | C16H18ClN3S |
| Formula Weight | 319.86 |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| Assay Percent Range | 1% w/v aqueous solution |
Thermo Scientific Chemicals Eriochrome Black T
CAS: 1787-61-7 Molecular Formula: C20H12N3NaO7S Molecular Weight (g/mol): 461.38 MDL Number: MFCD00003935 InChI Key: JHUJLRKQZAPSDP-GXTSIBQPSA-M Synonym: C.I. 14645; Mordant Black 11 PubChem CID: 87355429 SMILES: [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O
| PubChem CID | 87355429 |
|---|---|
| CAS | 1787-61-7 |
| Molecular Weight (g/mol) | 461.38 |
| MDL Number | MFCD00003935 |
| SMILES | [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O |
| Synonym | C.I. 14645; Mordant Black 11 |
| InChI Key | JHUJLRKQZAPSDP-GXTSIBQPSA-M |
| Molecular Formula | C20H12N3NaO7S |
Thermo Scientific Chemicals Methyl blue
CAS: 28983-56-4 Molecular Formula: C37H26N3Na2O9S3 Molecular Weight (g/mol): 798.79 MDL Number: MFCD00058509 InChI Key: TUHAIJABPUJAEY-UHFFFAOYSA-K Synonym: Acid blue 93; C.I. 42780 PubChem CID: 76956083 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O
| PubChem CID | 76956083 |
|---|---|
| CAS | 28983-56-4 |
| Molecular Weight (g/mol) | 798.79 |
| MDL Number | MFCD00058509 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| Synonym | Acid blue 93; C.I. 42780 |
| InChI Key | TUHAIJABPUJAEY-UHFFFAOYSA-K |
| Molecular Formula | C37H26N3Na2O9S3 |
Thermo Scientific Chemicals Basic Fuchsin
CAS: 632-99-5 Molecular Formula: C20H20ClN3 Molecular Weight (g/mol): 337.85 MDL Number: MFCD00012569 InChI Key: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC Name: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride SMILES: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| PubChem CID | 12447 |
|---|---|
| CAS | 632-99-5 |
| Molecular Weight (g/mol) | 337.85 |
| MDL Number | MFCD00012569 |
| SMILES | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| IUPAC Name | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
| InChI Key | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molecular Formula | C20H20ClN3 |
Thermo Scientific Chemicals Indigo carmine
CAS: 860-22-0 Molecular Formula: C16H8N2Na2O8S2 Molecular Weight (g/mol): 466.35 MDL Number: MFCD00005723 InChI Key: KHLVKKOJDHCJMG-QDBORUFSSA-L Synonym: indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 PubChem CID: 5284351 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O
| PubChem CID | 5284351 |
|---|---|
| CAS | 860-22-0 |
| Molecular Weight (g/mol) | 466.35 |
| MDL Number | MFCD00005723 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O |
| Synonym | indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 |
| InChI Key | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| Molecular Formula | C16H8N2Na2O8S2 |
Thermo Scientific Chemicals Bromocresol Green
CAS: 76-60-8 Molecular Formula: C21H14Br4O5S Molecular Weight (g/mol): 698.014 MDL Number: MFCD00005874 InChI Key: FRPHFZCDPYBUAU-UHFFFAOYSA-N Synonym: Bromcresol Green PubChem CID: 6451 IUPAC Name: 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol SMILES: CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br
| PubChem CID | 6451 |
|---|---|
| CAS | 76-60-8 |
| Molecular Weight (g/mol) | 698.014 |
| MDL Number | MFCD00005874 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| Synonym | Bromcresol Green |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol |
| InChI Key | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| Molecular Formula | C21H14Br4O5S |
Thermo Scientific Chemicals Bromocresol Green sodium salt, 0.04% w/v aq. soln.
CAS: 62625-32-5 MDL Number: MFCD00148898 Synonym: Bromocresol Green, water soluble
| CAS | 62625-32-5 |
|---|---|
| MDL Number | MFCD00148898 |
| Synonym | Bromocresol Green, water soluble |
Bromocresol Purple sodium salt, 0.04% w/v aq. soln.
CAS: 62625-30-3 Molecular Formula: C21H15Br2NaO5S Molecular Weight (g/mol): 562.204 MDL Number: MFCD00148896 InChI Key: KVSJYIXUWNOWBD-UGAWPWHASA-M Synonym: Bromocresol Purple, water soluble PubChem CID: 23665568 IUPAC Name: sodium;2-[(E)-(3-bromo-4-hydroxy-5-methylphenyl)-(3-bromo-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate SMILES: CC1=CC(=C(C2=CC=CC=C2S(=O)(=O)[O-])C3=CC(=C(C(=C3)Br)O)C)C=C(C1=O)Br.[Na+]
| PubChem CID | 23665568 |
|---|---|
| CAS | 62625-30-3 |
| Molecular Weight (g/mol) | 562.204 |
| MDL Number | MFCD00148896 |
| SMILES | CC1=CC(=C(C2=CC=CC=C2S(=O)(=O)[O-])C3=CC(=C(C(=C3)Br)O)C)C=C(C1=O)Br.[Na+] |
| Synonym | Bromocresol Purple, water soluble |
| IUPAC Name | sodium;2-[(E)-(3-bromo-4-hydroxy-5-methylphenyl)-(3-bromo-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzenesulfonate |
| InChI Key | KVSJYIXUWNOWBD-UGAWPWHASA-M |
| Molecular Formula | C21H15Br2NaO5S |
Thermo Scientific Chemicals Cresol Red
CAS: 1733-12-6 Molecular Formula: C21H18O5S Molecular Weight (g/mol): 382.43 MDL Number: MFCD00005878 InChI Key: OBRMNDMBJQTZHV-UHFFFAOYSA-N Synonym: o-Cresolsulfonephthalein PubChem CID: 73013 ChEBI: CHEBI:86218 IUPAC Name: 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol SMILES: CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1
| PubChem CID | 73013 |
|---|---|
| CAS | 1733-12-6 |
| Molecular Weight (g/mol) | 382.43 |
| ChEBI | CHEBI:86218 |
| MDL Number | MFCD00005878 |
| SMILES | CC1=CC(=CC=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| Synonym | o-Cresolsulfonephthalein |
| IUPAC Name | 4-[3-(4-hydroxy-3-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-2-methylphenol |
| InChI Key | OBRMNDMBJQTZHV-UHFFFAOYSA-N |
| Molecular Formula | C21H18O5S |
Thermo Scientific Chemicals Fluorescein isothiocyanate, isomer 1, 95%
CAS: 3326-32-7 Molecular Formula: C21H11NO5S Molecular Weight (g/mol): 389.381 MDL Number: MFCD00005063 InChI Key: MHMNJMPURVTYEJ-UHFFFAOYSA-N Synonym: fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer PubChem CID: 18730 ChEBI: CHEBI:37918 IUPAC Name: 3',6'-dihydroxy-6-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
| PubChem CID | 18730 |
|---|---|
| CAS | 3326-32-7 |
| Molecular Weight (g/mol) | 389.381 |
| ChEBI | CHEBI:37918 |
| MDL Number | MFCD00005063 |
| SMILES | C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Synonym | fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer |
| IUPAC Name | 3',6'-dihydroxy-6-isothiocyanatospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | MHMNJMPURVTYEJ-UHFFFAOYSA-N |
| Molecular Formula | C21H11NO5S |
Thermo Scientific Chemicals Brilliant Green
CAS: 633-03-4 Molecular Formula: C27H34N2O4S Molecular Weight (g/mol): 482.639 MDL Number: MFCD00011880 InChI Key: NNBFNNNWANBMTI-UHFFFAOYSA-M Synonym: Basic Green 1; C.I. 42040 PubChem CID: 12449 IUPAC Name: [4-[[4-(diethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;hydrogen sulfate SMILES: CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=CC=CC=C3.OS(=O)(=O)[O-]
| PubChem CID | 12449 |
|---|---|
| CAS | 633-03-4 |
| Molecular Weight (g/mol) | 482.639 |
| MDL Number | MFCD00011880 |
| SMILES | CCN(CC)C1=CC=C(C=C1)C(=C2C=CC(=[N+](CC)CC)C=C2)C3=CC=CC=C3.OS(=O)(=O)[O-] |
| Synonym | Basic Green 1; C.I. 42040 |
| IUPAC Name | [4-[[4-(diethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;hydrogen sulfate |
| InChI Key | NNBFNNNWANBMTI-UHFFFAOYSA-M |
| Molecular Formula | C27H34N2O4S |
Murexide
CAS: 3051-09-0 Molecular Formula: C8H3N5O6-2 Molecular Weight (g/mol): 265.141 MDL Number: MFCD00012777 InChI Key: MUMMBXDKKJEASE-UHFFFAOYSA-L Synonym: murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate PubChem CID: 51381221 IUPAC Name: 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate SMILES: C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O
| PubChem CID | 51381221 |
|---|---|
| CAS | 3051-09-0 |
| Molecular Weight (g/mol) | 265.141 |
| MDL Number | MFCD00012777 |
| SMILES | C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O |
| Synonym | murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate |
| IUPAC Name | 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate |
| InChI Key | MUMMBXDKKJEASE-UHFFFAOYSA-L |
| Molecular Formula | C8H3N5O6-2 |
Fluorescamine
CAS: 38183-12-9 Molecular Formula: C17H10O4 Molecular Weight (g/mol): 278.26 MDL Number: MFCD00005928 InChI Key: ZFKJVJIDPQDDFY-UHFFFAOYNA-N Synonym: fluorescamine,fluram,spiro furan-2 3h ,1' 3'h-isobenzofuran-3,3'-dione, 4-phenyl,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dione,4-phenylspiro furan-2 3h ,1'-phthalan-3,3'-dione,4-phenylspiro furan-2 3h-1'-3'-h-isobenzofuran-3,3'-dione,zfkjvjidpqddfy-uhfffaoysa,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dion PubChem CID: 37927 SMILES: O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12
| PubChem CID | 37927 |
|---|---|
| CAS | 38183-12-9 |
| Molecular Weight (g/mol) | 278.26 |
| MDL Number | MFCD00005928 |
| SMILES | O=C1OC2(OC=C(C2=O)C2=CC=CC=C2)C2=CC=CC=C12 |
| Synonym | fluorescamine,fluram,spiro furan-2 3h ,1' 3'h-isobenzofuran-3,3'-dione, 4-phenyl,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dione,4-phenylspiro furan-2 3h ,1'-phthalan-3,3'-dione,4-phenylspiro furan-2 3h-1'-3'-h-isobenzofuran-3,3'-dione,zfkjvjidpqddfy-uhfffaoysa,4'-phenylspiro 2-benzofuran-3,2'-furan-1,3'-dion |
| InChI Key | ZFKJVJIDPQDDFY-UHFFFAOYNA-N |
| Molecular Formula | C17H10O4 |