Learn More
tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%, ACROS Organics™
Brand: Acros Organics 209860050
Additional Details : CAS Number : 69739-34-0 Weight : 0.05575kg Transport : UN number : 2920 Chem class : 8 Pack group : II
| Packaging | Glass bottle |
|---|---|
| Quantity | 5mL |
Chemical Identifiers
| 69739-34-0 | |
| 264.334 | |
| WLLIXJBWWFGEHT-UHFFFAOYSA-N | |
| 123564 |
| C7H15F3O3SSi | |
| MFCD00000405 | |
| Trifluoromethanesulfonic acid tert-butyldimethylsilyl ester |
Specifications
| tert-Butyldimethylsilyl trifluoromethanesulfonate | |
| Authentic | |
| 1.3850 to 1.3880 (20°C, 589nm) | |
| ≥97.5% | |
| 5mL | |
| CF3SO3Si(CH3)2C(CH3)3 | |
| 10,63; 11,90; 12,86; 13,50; 17,55 | |
| WLLIXJBWWFGEHT-UHFFFAOYSA-N | |
| [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate | |
| 123564 | |
| Fuming Liquid |
| 69739-34-0 | |
| Glass bottle | |
| Colorless to Yellow | |
| 98% | |
| C7H15F3O3SSi | |
| MFCD00000405 | |
| Trifluoromethanesulfonic acid tert-butyldimethylsilyl ester | |
| CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F | |
| 264.334 | |
| 264.33 |