Learn More
Alfa Aesar™ Nafion™ D-520 dispersion, 5% w/w in water and 1-propanol, ≥1.00 meq/g exchange capacity
Preparation of thin films and coatings; proton exchange membranes
Brand: Alfa Aesar™ 042118.AE
Additional Details : CAS Number : 31175-20-9 Weight : 0.01000kg Transport : UN number : 1987 Chem class : 3 Pack group : III
| Quantity | 100mL |
|---|
Chemical Identifiers
| 31175-20-9 | |
| 544.135 | |
| FOYUGSIADQEOEK-UHFFFAOYSA-N | |
| 61889 | |
| C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)O)(F)F)F)(F)F)F.C(=C(F)F)(F)F |
| C9HF17O5S | |
| MFCD00132790 | |
| nafion, nafion nr 50 beads 10-35 mesh, perfluoro 2-2-sulfonylethoxy propyl vinyl ether-tetrafluoroethylene copolymer, tetrafluoroethylene-perfluoro 2-2-sulfonylethoxy propyl vinyl ether copolymer, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoroethanesulfonyl fluoride-tetrafl, ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-1,2,2-trifluoro-1-trifluoromethyl-2-1,2,2-trifluorovinyl oxy ethoxy-, pol, ethanesulfonic acid, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoro-, polymer, nafion n-324 membrane, 0.15mm 0.006in thick, teflon fabric reinforced, nafion nre-212 membrane, 0.05mm thick, >=0.92 meq/g exchange capacity, nafion d-520 dispersion w/w in water and 1-propanol, >=1.00 meq/g exchange capacity | |
| 1,1,2,2-tetrafluoroethene;1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonic acid |
Specifications
| Nafion™ D-520 dispersion | |
| 31175-20-9 | |
| C9HF17O5S | |
| UN1987 | |
| Insoluble in water. | |
| C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)O)(F)F)F)(F)F)F.C(=C(F)F)(F)F | |
| 544.135 | |
| Liquid | |
| 5% w/w in water and 1-propanol | |
| 24°C (75°F) |
| ≥0.92meq/g exchange capacity | |
| 0.93 g/mL | |
| MFCD00132790 | |
| nafion, nafion nr 50 beads 10-35 mesh, perfluoro 2-2-sulfonylethoxy propyl vinyl ether-tetrafluoroethylene copolymer, tetrafluoroethylene-perfluoro 2-2-sulfonylethoxy propyl vinyl ether copolymer, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoroethanesulfonyl fluoride-tetrafl, ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-1,2,2-trifluoro-1-trifluoromethyl-2-1,2,2-trifluorovinyl oxy ethoxy-, pol, ethanesulfonic acid, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoro-, polymer, nafion n-324 membrane, 0.15mm 0.006in thick, teflon fabric reinforced, nafion nre-212 membrane, 0.05mm thick, >=0.92 meq/g exchange capacity, nafion d-520 dispersion w/w in water and 1-propanol, >=1.00 meq/g exchange capacity | |
| FOYUGSIADQEOEK-UHFFFAOYSA-N | |
| 1,1,2,2-tetrafluoroethene;1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonic acid | |
| 61889 | |
| Colorless to Yellow | |
| 100mL |