Learn More
L-Bornyl acetate, 95%, Thermo Scientific™
Brand: Thermo Scientific Acros 106551000
Additional Details : CAS Number : 5655-61-8 Weight : 0.15000kg
| Quantity | 100g |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 5655-61-8 | |
| 196.29 | |
| KGEKLUUHTZCSIP-HOSYDEDBSA-N | |
| 44630108 | |
| CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| C12H20O2 | |
| MFCD00867808,MFCD00135942,MFCD00135942 | |
| bornyl acetate, -bornyl acetate | |
| [(1R,3S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] acetate |
Specifications
| L-Bornyl acetate | |
| 5655-61-8 | |
| Colorless | |
| 84°C | |
| Authentic | |
| MFCD00867808,MFCD00135942,MFCD00135942 | |
| Glass bottle | |
| 1.4620 to 1.465 | |
| 100g | |
| KGEKLUUHTZCSIP-HOSYDEDBSA-N | |
| CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C | |
| -38 | |
| 44630108 | |
| Liquid |
| 95% | |
| 0.9875g/mL | |
| 223°C to 224°C | |
| 98% min. (as C12H20O2) Total esters (GC) | |
| C12H20O2 | |
| 06,82 | |
| 15,1341 | |
| bornyl acetate, -bornyl acetate | |
| Solubility in water: .. Other solubilities: miscible with 95% alcohol and ether | |
| 0.9875 | |
| [(1R,3S)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] acetate | |
| 196.29 | |
| 196.29 | |
| 95% |
RUO – Research Use Only