Learn More
Gluconic Acid, 50 wt. % Solution in Water, Thermo Scientific™
Brand: Thermo Scientific Acros 119890010
Additional Details : CAS Number : 526-95-4 Weight : 1.28000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1L |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 526-95-4 | |
| 196.155 | |
| RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
| 10690 | |
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| C6H12O7 | |
| MFCD00004240 | |
| gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
| CHEBI:33198 | |
| C(C(C(C(C(C(=O)O)O)O)O)O)O |
Specifications
| Gluconic acid | |
| C6H12O7 | |
| 03, 542 | |
| 1000ppm max. | |
| RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
| (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | |
| 10690 | |
| 196.16 | |
| 1.23g/mL | |
| White to Yellow | |
| 10ppm max. | |
| 3% max. | |
| 1.22 to 1.25 (20°C) |
| 526-95-4,7732-18-5 | |
| MFCD00004240 | |
| 15, 4492 | |
| gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
| C(C(C(C(C(C(=O)O)O)O)O)O)O | |
| 196.155 | |
| CHEBI:33198 | |
| Crystalline Powder or Crystals | |
| 49 to 55% (Titrimetry other) | |
| 1L | |
| Glass bottle | |
| 3 % max. | |
| 1000ppm max. |
RUO – Research Use Only