Learn More
Ammonium Sulfate, Fisher BioReagents
Brand: Fisher Bioreagents BP212-212
Additional Details : CAS Number : 7783-20-2 Weight : 2.55000kg
| Packaging | Poly Bottle |
|---|---|
| Quantity | 2.5kg |
Description
This enzyme-grade Ammonium Sulfate is suitable for use in the purification of proteins.Chemical Identifiers
| 7783-20-2 | |
| 132.134 | |
| Sulfuric Acid Diammonium Salt, Diammonium Sulfate | |
| CHEBI:62946 |
| H8N2O4S | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| 6097028 |
Specifications
| 0.03 max. at 260nm, 0.025 max. at 280nm | |
| 7783-20-2 | |
| H8N2O4S | |
| 0.5ppm max. | |
| Sulfuric Acid Diammonium Salt, Diammonium Sulfate | |
| [NH4+].[NH4+].[O-]S(=O)(=O)[O-] | |
| 132.134 | |
| CHEBI:62946 | |
| Solid | |
| Pass Test | |
| 5ppm max. | |
| Poly Bottle | |
| Colorless | |
| 5 to 6 |
| Ammonium Sulfate | |
| ≥99.5% | |
| (NH4)2SO4 | |
| 15, 552 | |
| BFNBIHQBYMNNAN-UHFFFAOYSA-N | |
| diazanium;sulfate | |
| 6097028 | |
| 132.14 | |
| 5ppm max. | |
| 0.005% max. | |
| 0.001 max. | |
| Protease free | |
| 280°C | |
| 2.5kg |