Learn More
Alfa Aesar™ 2-(3-Fluorophenylamino)benzoic acid, 98%
Brand: Alfa Aesar™ 043852.18
Additional Details : CAS Number : 54-59-1 Weight : 0.05000kg
| Quantity | 50g |
|---|
Chemical Identifiers
| 54-59-1 | |
| 231.226 | |
| HYZIDPAMLUKNIR-UHFFFAOYSA-N | |
| 120158 | |
| C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)F |
| C13H10FNO2 | |
| MFCD01675228 | |
| n-3-fluorophenyl anthranilic acid, 2-3-fluorophenyl amino benzoic acid, anthranilic acid, n-m-fluorophenyl, benzoic acid, 2-3-fluorophenyl amino, n-3-fluorophenyl anthranilsaeure german, acide n-3-flurophenyl anthranilique french, 2-3-fluorophenylamino benzoic acid, n-3-fluorophenyl anthranilsaeure, acide n-3-flurophenyl anthranilique | |
| 2-(3-fluoroanilino)benzoic acid |
Specifications
| 2- (3-Fluorophenylamino)benzoic acid | |
| 158°C to 163°C | |
| 54-59-1 | |
| MFCD01675228 | |
| HYZIDPAMLUKNIR-UHFFFAOYSA-N | |
| 2-(3-fluoroanilino)benzoic acid | |
| 120158 | |
| Powder |
| Gray to Yellow | |
| 50g | |
| C13H10FNO2 | |
| n-3-fluorophenyl anthranilic acid, 2-3-fluorophenyl amino benzoic acid, anthranilic acid, n-m-fluorophenyl, benzoic acid, 2-3-fluorophenyl amino, n-3-fluorophenyl anthranilsaeure german, acide n-3-flurophenyl anthranilique french, 2-3-fluorophenylamino benzoic acid, n-3-fluorophenyl anthranilsaeure, acide n-3-flurophenyl anthranilique | |
| C1=CC=C(C(=C1)C(=O)O)NC2=CC(=CC=C2)F | |
| 231.226 | |
| 231.22 | |
| 98% |