Filtered Search Results
Copper(II) nitrate trihydrate, 99%, for analysis
CAS: 10031-43-3 MDL Number: MFCD00149671 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| MDL Number | MFCD00149671 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
Copper(II) sulfate pentahydrate, 98%, extra pure
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper;sulfate;pentahydrate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper;sulfate;pentahydrate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Copper(I) iodide, 99.995%, (trace metal basis)
CAS: 7681-65-4 Molecular Formula: CuI Molecular Weight (g/mol): 190.45 MDL Number: MFCD00010978 Synonym: cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g
| CAS | 7681-65-4 |
|---|---|
| Molecular Weight (g/mol) | 190.45 |
| MDL Number | MFCD00010978 |
| Synonym | cuprous iodide,copper l iodide,copper i iodide metals basis,marshite,copper i iodide 250g |
| Molecular Formula | CuI |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Copper(II) sulfate, 98+%, for analysis, anhydrous
CAS: 7758-98-7 Molecular Formula: CuO4S Molecular Weight (g/mol): 159.6 InChI Key: ARUVKPQLZAKDPS-UHFFFAOYSA-L Synonym: copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle PubChem CID: 24462 ChEBI: CHEBI:23414 IUPAC Name: copper;sulfate SMILES: [O-]S(=O)(=O)[O-].[Cu+2]
| PubChem CID | 24462 |
|---|---|
| CAS | 7758-98-7 |
| Molecular Weight (g/mol) | 159.6 |
| ChEBI | CHEBI:23414 |
| SMILES | [O-]S(=O)(=O)[O-].[Cu+2] |
| Synonym | copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle |
| IUPAC Name | copper;sulfate |
| InChI Key | ARUVKPQLZAKDPS-UHFFFAOYSA-L |
| Molecular Formula | CuO4S |
Copper(I) chloride, 97%, pure, with anti-caking agent
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 99 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 99 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |
Copper(II) Chloride Dihydrate, Certified AR for Analysis, Fisher Chemical™
CAS: 10125-13-0 Molecular Formula: Cl2CuH4O2 Molecular Weight (g/mol): 170.48 MDL Number: MFCD00149674 InChI Key: MPTQRFCYZCXJFQ-UHFFFAOYSA-L IUPAC Name: copper(2+) dihydrate dichloride SMILES: O.O.[Cl-].[Cl-].[Cu++]
| CAS | 10125-13-0 |
|---|---|
| Molecular Weight (g/mol) | 170.48 |
| MDL Number | MFCD00149674 |
| SMILES | O.O.[Cl-].[Cl-].[Cu++] |
| IUPAC Name | copper(2+) dihydrate dichloride |
| InChI Key | MPTQRFCYZCXJFQ-UHFFFAOYSA-L |
| Molecular Formula | Cl2CuH4O2 |
Copper(II) carbonate basic, pure, 54-56% Cu
CAS: 12069-69-1 Molecular Formula: CCuO3·CuO2H2 Molecular Weight (g/mol): 221.1 MDL Number: MFCD00010976 Synonym: Copper(II)hydroxide carbonate
| CAS | 12069-69-1 |
|---|---|
| Molecular Weight (g/mol) | 221.1 |
| MDL Number | MFCD00010976 |
| Synonym | Copper(II)hydroxide carbonate |
| Molecular Formula | CCuO3·CuO2H2 |
Copper(II) sulfate pentahydrate, 99%
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper;sulfate;pentahydrate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper;sulfate;pentahydrate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Copper(II) acetate monohydrate, 98+%
CAS: 6046-93-1 Molecular Formula: C4H8CuO5 Molecular Weight (g/mol): 199.65 MDL Number: MFCD00149570 InChI Key: NWFNSTOSIVLCJA-UHFFFAOYSA-L Synonym: copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate PubChem CID: 165397 IUPAC Name: copper;diacetate;hydrate SMILES: O.[Cu++].CC([O-])=O.CC([O-])=O
| PubChem CID | 165397 |
|---|---|
| CAS | 6046-93-1 |
| Molecular Weight (g/mol) | 199.65 |
| MDL Number | MFCD00149570 |
| SMILES | O.[Cu++].CC([O-])=O.CC([O-])=O |
| Synonym | copper ii acetate monohydrate,cupric acetate monohydrate,copper diacetate monohydrate,copper acetate monohydrate,copper 2+ acetate, monohydrate,acetic acid, copper 2+ salt, monohydrate,verdigris,copper acetate hydrate,diacetoxycopper hydrate,copper acetate, hydrate |
| IUPAC Name | copper;diacetate;hydrate |
| InChI Key | NWFNSTOSIVLCJA-UHFFFAOYSA-L |
| Molecular Formula | C4H8CuO5 |
Copper(I) chloride, 99% (metals basis)
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 98.996 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 98.996 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |
Copper(II) chloride hydrate, Puratronic™, 99.999% (metals basis)
CAS: 10125-13-0 Molecular Formula: Cl2CuH4O2 Molecular Weight (g/mol): 170.48 MDL Number: MFCD00149674 InChI Key: MPTQRFCYZCXJFQ-UHFFFAOYSA-L Synonym: coppertrace,copper ii chloride dihydrate,copper chloride dihydrate,caswell no. 235a,copper 2+ chloride dihydrate,cupric chloride usp,copper chloride cucl2 , dihydrate,epa pesticide chemical code 023701 PubChem CID: 61482 ChEBI: CHEBI:86318 IUPAC Name: dichlorocopper;dihydrate SMILES: O.O.[Cl-].[Cl-].[Cu++]
| PubChem CID | 61482 |
|---|---|
| CAS | 10125-13-0 |
| Molecular Weight (g/mol) | 170.48 |
| ChEBI | CHEBI:86318 |
| MDL Number | MFCD00149674 |
| SMILES | O.O.[Cl-].[Cl-].[Cu++] |
| Synonym | coppertrace,copper ii chloride dihydrate,copper chloride dihydrate,caswell no. 235a,copper 2+ chloride dihydrate,cupric chloride usp,copper chloride cucl2 , dihydrate,epa pesticide chemical code 023701 |
| IUPAC Name | dichlorocopper;dihydrate |
| InChI Key | MPTQRFCYZCXJFQ-UHFFFAOYSA-L |
| Molecular Formula | Cl2CuH4O2 |
Copper(II) acetate, anhydrous, 98%
CAS: 142-71-2 Molecular Formula: C4H6CuO4 Molecular Weight (g/mol): 181.634 MDL Number: MFCD00008690 InChI Key: OPQARKPSCNTWTJ-UHFFFAOYSA-L Synonym: copper ii acetate,cupric acetate,copper diacetate,copper acetate,venus copper,copper 2+ diacetate,cupric diacetate,neutral verdigris,crystals of venus PubChem CID: 8895 IUPAC Name: copper;diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Cu+2]
| PubChem CID | 8895 |
|---|---|
| CAS | 142-71-2 |
| Molecular Weight (g/mol) | 181.634 |
| MDL Number | MFCD00008690 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
| Synonym | copper ii acetate,cupric acetate,copper diacetate,copper acetate,venus copper,copper 2+ diacetate,cupric diacetate,neutral verdigris,crystals of venus |
| IUPAC Name | copper;diacetate |
| InChI Key | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6CuO4 |
Copper(I) chloride, 99.99%, (trace metal basis), extra pure
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 99 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 99 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |