Reactive Nonmetal Salts
Filtered Search Results
Phosphorus pentasulfide, 98+%, Thermo Scientific Chemicals
CAS: 1314-80-3 Molecular Formula: P4S10 Molecular Weight (g/mol): 444.48 MDL Number: MFCD00011441 InChI Key: CYQAYERJWZKYML-UHFFFAOYSA-N Synonym: phosphorus pentasulfide,sulfur phosphide,diphosphorus pentasulfide,diphosphorus pentasulphide,tetraphosphorus decasulfide,phosphoric sulfide,phosphorus persulfide,phosphorus pentasulphide,thiophosphoric anhydride,sirnik fosforecny czech PubChem CID: 14817 SMILES: P12(=S)SP3(=S)SP(=S)(S1)SP(=S)(S2)S3
| PubChem CID | 14817 |
|---|---|
| CAS | 1314-80-3 |
| Molecular Weight (g/mol) | 444.48 |
| MDL Number | MFCD00011441 |
| SMILES | P12(=S)SP3(=S)SP(=S)(S1)SP(=S)(S2)S3 |
| Synonym | phosphorus pentasulfide,sulfur phosphide,diphosphorus pentasulfide,diphosphorus pentasulphide,tetraphosphorus decasulfide,phosphoric sulfide,phosphorus persulfide,phosphorus pentasulphide,thiophosphoric anhydride,sirnik fosforecny czech |
| InChI Key | CYQAYERJWZKYML-UHFFFAOYSA-N |
| Molecular Formula | P4S10 |
Sulfaguanidine, 98%, Thermo Scientific Chemicals
CAS: 57-67-0 Molecular Formula: C7H10N4O2S Molecular Weight (g/mol): 214.25 MDL Number: MFCD00038136 InChI Key: BRBKOPJOKNSWSG-UHFFFAOYSA-N Synonym: sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil PubChem CID: 5324 IUPAC Name: 2-(4-aminophenyl)sulfonylguanidine SMILES: C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N
| PubChem CID | 5324 |
|---|---|
| CAS | 57-67-0 |
| Molecular Weight (g/mol) | 214.25 |
| MDL Number | MFCD00038136 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)N=C(N)N |
| Synonym | sulfaguanidine,sulphaguanidine,sulfaguanidin,guanicil,sulfaguine,aterian,sulfanilguanidine,sulfanilylguanidine,sulfoguanidine,abiguanil |
| IUPAC Name | 2-(4-aminophenyl)sulfonylguanidine |
| InChI Key | BRBKOPJOKNSWSG-UHFFFAOYSA-N |
| Molecular Formula | C7H10N4O2S |
Phosphorus tribromide, 1.0M solution in dichloromethane, AcroSeal™, Thermo Scientific Chemicals
CAS: 7789-60-8 | Molecular Formula: Br3P | Molecular Weight: 270.69 g/mol
| Linear Formula | PBr2 |
|---|---|
| Molecular Weight (g/mol) | 270.69 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Phosphorus tribromide |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Density | 1.4880g/mL |
| PubChem CID | 24614 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00011436 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| Molecular Formula | Br3P |
| EINECS Number | 232-178-2 |
| Formula Weight | 270.69 |
| Specific Gravity | 1.488 |
chlorotripyrrolidinophosphonium hexafluorophosphate, 98%, Thermo Scientific™
CAS: 133894-48-1 Molecular Formula: C12H24ClN3P·F6P Molecular Weight (g/mol): 421.73 InChI Key: BSCYRXJVGSZNKX-UHFFFAOYSA-N Synonym: pyclop,chlorotripyrrolidinophosphonium hexafluorophosphate,chlorotripyrrolidinophosphonium hexa-fluorophosphate,chlorotri 1-pyrrolidinyl phosphonium hexafluorophosphate, 98+%,pyciop,ref dupl: pyclop,chlorotripyrrolidino,acmc-1c01w,ksc177a1n,chlorotripyrrolidinophosphoniumhexafluorophosphat PubChem CID: 16211753 IUPAC Name: chloro(tripyrrolidin-1-yl)phosphanium;hexafluorophosphate SMILES: C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Cl.F[P-](F)(F)(F)(F)F
| PubChem CID | 16211753 |
|---|---|
| CAS | 133894-48-1 |
| Molecular Weight (g/mol) | 421.73 |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Cl.F[P-](F)(F)(F)(F)F |
| Synonym | pyclop,chlorotripyrrolidinophosphonium hexafluorophosphate,chlorotripyrrolidinophosphonium hexa-fluorophosphate,chlorotri 1-pyrrolidinyl phosphonium hexafluorophosphate, 98+%,pyciop,ref dupl: pyclop,chlorotripyrrolidino,acmc-1c01w,ksc177a1n,chlorotripyrrolidinophosphoniumhexafluorophosphat |
| IUPAC Name | chloro(tripyrrolidin-1-yl)phosphanium;hexafluorophosphate |
| InChI Key | BSCYRXJVGSZNKX-UHFFFAOYSA-N |
| Molecular Formula | C12H24ClN3P·F6P |
Phosphorus(V) oxide, Puratronic™, 99.9925% (metals basis), Thermo Scientific Chemicals
CAS: 1314-56-3 Molecular Formula: O5P2 Molecular Weight (g/mol): 141.94 MDL Number: MFCD00011440 InChI Key: DLYUQMMRRRQYAE-UHFFFAOYSA-N IUPAC Name: tricyclo[3.3.1.1⊃3,⊃7]tetraphosphoxane-1,3,5,7-tetrone SMILES: O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
| CAS | 1314-56-3 |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| MDL Number | MFCD00011440 |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3 |
| IUPAC Name | tricyclo[3.3.1.1⊃3,⊃7]tetraphosphoxane-1,3,5,7-tetrone |
| InChI Key | DLYUQMMRRRQYAE-UHFFFAOYSA-N |
| Molecular Formula | O5P2 |