Acrylic acids and derivatives
Filtered Search Results
Allyl acrylate, 95%, stab. with 4-methoxyphenol, Thermo Scientific Chemicals
CAS: 999-55-3 Molecular Formula: C6H8O2 Molecular Weight (g/mol): 112.128 MDL Number: MFCD00014949 InChI Key: QTECDUFMBMSHKR-UHFFFAOYSA-N Synonym: allyl acrylate,acrylic acid, allyl ester,2-propenoic acid, 2-propenyl ester,unii-705ga5o3us,ccris 4745,acrylic acid allyl ester,2-propenoic acid, 2-propen-1-yl ester,allylacrylate,acrylic acid allyl,acmc-20alut PubChem CID: 13835 IUPAC Name: prop-2-enyl prop-2-enoate SMILES: C=CCOC(=O)C=C
| PubChem CID | 13835 |
|---|---|
| CAS | 999-55-3 |
| Molecular Weight (g/mol) | 112.128 |
| MDL Number | MFCD00014949 |
| SMILES | C=CCOC(=O)C=C |
| Synonym | allyl acrylate,acrylic acid, allyl ester,2-propenoic acid, 2-propenyl ester,unii-705ga5o3us,ccris 4745,acrylic acid allyl ester,2-propenoic acid, 2-propen-1-yl ester,allylacrylate,acrylic acid allyl,acmc-20alut |
| IUPAC Name | prop-2-enyl prop-2-enoate |
| InChI Key | QTECDUFMBMSHKR-UHFFFAOYSA-N |
| Molecular Formula | C6H8O2 |
Cyclohexyl acrylate, 98+%, stab. with 100ppm 4-methoxyphenol, Thermo Scientific Chemicals
CAS: 3066-71-5 Molecular Formula: C9H14O2 Molecular Weight (g/mol): 154.21 MDL Number: MFCD00046349 InChI Key: KBLWLMPSVYBVDK-UHFFFAOYSA-N Synonym: cyclohexyl acrylate,2-propenoic acid, cyclohexyl ester,sartomer sr 220,acrylic acid, cyclohexyl ester,acrylic acid cyclohexyl ester,cyclohexylacrylate,acrylic acid cyclohexyl,acmc-209slu,wln: l6tj aov1u1,4-06-00-00038 beilstein handbook reference PubChem CID: 18298 IUPAC Name: cyclohexyl prop-2-enoate SMILES: C=CC(=O)OC1CCCCC1
| PubChem CID | 18298 |
|---|---|
| CAS | 3066-71-5 |
| Molecular Weight (g/mol) | 154.21 |
| MDL Number | MFCD00046349 |
| SMILES | C=CC(=O)OC1CCCCC1 |
| Synonym | cyclohexyl acrylate,2-propenoic acid, cyclohexyl ester,sartomer sr 220,acrylic acid, cyclohexyl ester,acrylic acid cyclohexyl ester,cyclohexylacrylate,acrylic acid cyclohexyl,acmc-209slu,wln: l6tj aov1u1,4-06-00-00038 beilstein handbook reference |
| IUPAC Name | cyclohexyl prop-2-enoate |
| InChI Key | KBLWLMPSVYBVDK-UHFFFAOYSA-N |
| Molecular Formula | C9H14O2 |
JNJ 10191584 maleate, Thermo Scientific™
CAS: 869497-75-6 Molecular Formula: C17H21ClN4O5 Molecular Weight (g/mol): 396.83 MDL Number: MFCD09878266 InChI Key: BODOIXYJOORQBQ-UHFFFAOYSA-N Synonym: jnj 10191584 maleate PubChem CID: 77519402 IUPAC Name: (6-chloro-1H-benzimidazol-2-yl)-(4-methylpiperazin-1-yl)methanone;formic acid;prop-2-enoic acid SMILES: OC=O.OC(=O)C=C.CN1CCN(CC1)C(=O)C1=NC2=CC=C(Cl)C=C2N1
| PubChem CID | 77519402 |
|---|---|
| CAS | 869497-75-6 |
| Molecular Weight (g/mol) | 396.83 |
| MDL Number | MFCD09878266 |
| SMILES | OC=O.OC(=O)C=C.CN1CCN(CC1)C(=O)C1=NC2=CC=C(Cl)C=C2N1 |
| Synonym | jnj 10191584 maleate |
| IUPAC Name | (6-chloro-1H-benzimidazol-2-yl)-(4-methylpiperazin-1-yl)methanone;formic acid;prop-2-enoic acid |
| InChI Key | BODOIXYJOORQBQ-UHFFFAOYSA-N |
| Molecular Formula | C17H21ClN4O5 |
Copper(II) acrylate, typically 95%, Thermo Scientific Chemicals
CAS: 20074-76-4 Molecular Formula: C6H6CuO4 Molecular Weight (g/mol): 205.656 MDL Number: MFCD00078371 InChI Key: XPLSDXJBKRIVFZ-UHFFFAOYSA-L Synonym: copper acrylate,copper ii acrylate,2-propenoic acid,copper 2+ salt 9ci,acmc-20aldy,acrylate,copper ii,copper 2+ diacrylate,copper 2+ ion diacrylate,bis acrylic acid copper ii salt,copper ii acrylate, typically PubChem CID: 13682633 IUPAC Name: copper;prop-2-enoate SMILES: C=CC(=O)[O-].C=CC(=O)[O-].[Cu+2]
| PubChem CID | 13682633 |
|---|---|
| CAS | 20074-76-4 |
| Molecular Weight (g/mol) | 205.656 |
| MDL Number | MFCD00078371 |
| SMILES | C=CC(=O)[O-].C=CC(=O)[O-].[Cu+2] |
| Synonym | copper acrylate,copper ii acrylate,2-propenoic acid,copper 2+ salt 9ci,acmc-20aldy,acrylate,copper ii,copper 2+ diacrylate,copper 2+ ion diacrylate,bis acrylic acid copper ii salt,copper ii acrylate, typically |
| IUPAC Name | copper;prop-2-enoate |
| InChI Key | XPLSDXJBKRIVFZ-UHFFFAOYSA-L |
| Molecular Formula | C6H6CuO4 |
Acrylic acid, tech. 90%, stab., Thermo Scientific™
CAS: 79-10-7 Molecular Formula: C3H4O2 Molecular Weight (g/mol): 72.063 MDL Number: MFCD00004367 InChI Key: NIXOWILDQLNWCW-UHFFFAOYSA-N Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: prop-2-enoic acid SMILES: C=CC(=O)O
| PubChem CID | 6581 |
|---|---|
| CAS | 79-10-7 |
| Molecular Weight (g/mol) | 72.063 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00004367 |
| SMILES | C=CC(=O)O |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | prop-2-enoic acid |
| InChI Key | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O2 |
n-Hexyl acrylate, 95%, stab. with hydroquinone, Thermo Scientific Chemicals
CAS: 2499-95-8 Molecular Formula: C9H16O2 Molecular Weight (g/mol): 156.225 MDL Number: MFCD00048881 InChI Key: LNMQRPPRQDGUDR-UHFFFAOYSA-N Synonym: hexyl acrylate,n-hexyl acrylate,hexyl 2-propenoate,2-propenoic acid, hexyl ester,n-hexylacrylate,ageflex n-ha,acrylic acid, hexyl ester,ccris 7038,acrylic acid-n-hexyl ester,hexylacrylate PubChem CID: 17259 IUPAC Name: hexyl prop-2-enoate SMILES: CCCCCCOC(=O)C=C
| PubChem CID | 17259 |
|---|---|
| CAS | 2499-95-8 |
| Molecular Weight (g/mol) | 156.225 |
| MDL Number | MFCD00048881 |
| SMILES | CCCCCCOC(=O)C=C |
| Synonym | hexyl acrylate,n-hexyl acrylate,hexyl 2-propenoate,2-propenoic acid, hexyl ester,n-hexylacrylate,ageflex n-ha,acrylic acid, hexyl ester,ccris 7038,acrylic acid-n-hexyl ester,hexylacrylate |
| IUPAC Name | hexyl prop-2-enoate |
| InChI Key | LNMQRPPRQDGUDR-UHFFFAOYSA-N |
| Molecular Formula | C9H16O2 |
1H,1H-Perfluorooctyl acrylate, 97%, stab. with 50ppm 4-methoxyphenol, Thermo Scientific™
CAS: 307-98-2 Molecular Formula: C11H5F15O2 Molecular Weight (g/mol): 454.135 MDL Number: MFCD00039248 InChI Key: YSQGYEYXKXGAQA-UHFFFAOYSA-N Synonym: 1h,1h-pentadecafluorooctyl acrylate,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl acrylate,1h,1h-perfluorooctyl acrylate,acrylic acid 1h,1h-pentadecafluoro-n-octyl ester,2-propenoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester,1h,1h-perfluoro-n-octyl acrylate,1h,1h-pentadecafluoro-n-octyl acrylate,1,1-dihydroperfluorooctyl acrylate,1,1-dyhydroperfluorooctyl acrylate,acrylic acid 1h,1h-perfluorooctyl ester PubChem CID: 67551 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl prop-2-enoate SMILES: C=CC(=O)OCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 67551 |
|---|---|
| CAS | 307-98-2 |
| Molecular Weight (g/mol) | 454.135 |
| MDL Number | MFCD00039248 |
| SMILES | C=CC(=O)OCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | 1h,1h-pentadecafluorooctyl acrylate,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl acrylate,1h,1h-perfluorooctyl acrylate,acrylic acid 1h,1h-pentadecafluoro-n-octyl ester,2-propenoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl ester,1h,1h-perfluoro-n-octyl acrylate,1h,1h-pentadecafluoro-n-octyl acrylate,1,1-dihydroperfluorooctyl acrylate,1,1-dyhydroperfluorooctyl acrylate,acrylic acid 1h,1h-perfluorooctyl ester |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl prop-2-enoate |
| InChI Key | YSQGYEYXKXGAQA-UHFFFAOYSA-N |
| Molecular Formula | C11H5F15O2 |
Poly(acrylamide), carboxyl modified, high carboxyl content, approx. MW 100,000, Thermo Scientific Chemicals
CAS: 62649-23-4 Molecular Formula: (C3H5NO)n Molecular Weight (g/mol): 237.19 MDL Number: MFCD00084393 InChI Key: DTBMFUOWAASNDB-UHFFFAOYSA-M Synonym: 2-propenamide, polymer with 2-propenoic acid and sodium 2-propenoate,sodium acrylamide acrylic acid acrylate PubChem CID: 23696299 IUPAC Name: sodium;prop-2-enamide;prop-2-enoate;prop-2-enoic acid SMILES: NC(=O)C(-*)C-*
| PubChem CID | 23696299 |
|---|---|
| CAS | 62649-23-4 |
| Molecular Weight (g/mol) | 237.19 |
| MDL Number | MFCD00084393 |
| SMILES | NC(=O)C(-*)C-* |
| Synonym | 2-propenamide, polymer with 2-propenoic acid and sodium 2-propenoate,sodium acrylamide acrylic acid acrylate |
| IUPAC Name | sodium;prop-2-enamide;prop-2-enoate;prop-2-enoic acid |
| InChI Key | DTBMFUOWAASNDB-UHFFFAOYSA-M |
| Molecular Formula | (C3H5NO)n |