Alkyl Halides
Filtered Search Results
Iodoform, 99+%
CAS: 75-47-8 Molecular Formula: CHI3 Molecular Weight (g/mol): 393.72 MDL Number: MFCD00001069 InChI Key: OKJPEAGHQZHRQV-UHFFFAOYSA-N Synonym: triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 PubChem CID: 6374 ChEBI: CHEBI:37758 IUPAC Name: iodoform SMILES: C(I)(I)I
| PubChem CID | 6374 |
|---|---|
| CAS | 75-47-8 |
| Molecular Weight (g/mol) | 393.72 |
| ChEBI | CHEBI:37758 |
| MDL Number | MFCD00001069 |
| SMILES | C(I)(I)I |
| Synonym | triiodomethane,methane, triiodo,carbon triiodide,jodoform,trijodmethane,dezinfekt v,jodoform czech,trijodmethane czech,ccris 346,unii-kxi2j76489 |
| IUPAC Name | iodoform |
| InChI Key | OKJPEAGHQZHRQV-UHFFFAOYSA-N |
| Molecular Formula | CHI3 |
Diiodomethane, 99+%, stabilized with silver wire
CAS: 75-11-6 Molecular Formula: CH2I2 Molecular Weight (g/mol): 267.84 MDL Number: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
| PubChem CID | 6346 |
|---|---|
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| MDL Number | MFCD00001079 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
| Molecular Formula | CH2I2 |
Dichloromethane, 99.8%, Extra Dry over Molecular Sieve, Stabilized, AcroSeal™
CAS: 75-09-2 Molecular Formula: CH2Cl2 Molecular Weight (g/mol): 84.93 MDL Number: MFCD00000881 InChI Key: YMWUJEATGCHHMB-UHFFFAOYSA-N Synonym: methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm PubChem CID: 6344 ChEBI: CHEBI:15767 IUPAC Name: dichloromethane SMILES: ClCCl
| PubChem CID | 6344 |
|---|---|
| CAS | 75-09-2 |
| Molecular Weight (g/mol) | 84.93 |
| ChEBI | CHEBI:15767 |
| MDL Number | MFCD00000881 |
| SMILES | ClCCl |
| Synonym | methylene chloride,methylene dichloride,methane, dichloro,methylene bichloride,methane dichloride,solaesthin,solmethine,freon 30,narkotil,aerothene mm |
| IUPAC Name | dichloromethane |
| InChI Key | YMWUJEATGCHHMB-UHFFFAOYSA-N |
| Molecular Formula | CH2Cl2 |
2,2-Dibromopropane, 98%
CAS: 594-16-1 Molecular Formula: C3H6Br2 Molecular Weight (g/mol): 201.89 MDL Number: MFCD00000119 InChI Key: ARITXYXYCOZKMU-UHFFFAOYSA-N Synonym: propane, 2,2-dibromo,2,2-dibromopropane,dibromo propane,2-dibrompropan,acmc-1aolk,ksc272i9f,inchi=1/c3h6br2/c1-3 2,4 5/h1-2h PubChem CID: 11658 IUPAC Name: 2,2-dibromopropane SMILES: CC(C)(Br)Br
| PubChem CID | 11658 |
|---|---|
| CAS | 594-16-1 |
| Molecular Weight (g/mol) | 201.89 |
| MDL Number | MFCD00000119 |
| SMILES | CC(C)(Br)Br |
| Synonym | propane, 2,2-dibromo,2,2-dibromopropane,dibromo propane,2-dibrompropan,acmc-1aolk,ksc272i9f,inchi=1/c3h6br2/c1-3 2,4 5/h1-2h |
| IUPAC Name | 2,2-dibromopropane |
| InChI Key | ARITXYXYCOZKMU-UHFFFAOYSA-N |
| Molecular Formula | C3H6Br2 |
Allyl bromide, 99%, stabilized
CAS: 106-95-6 Molecular Formula: C3H5Br Molecular Weight (g/mol): 120.98 MDL Number: MFCD00000244 InChI Key: BHELZAPQIKSEDF-UHFFFAOYSA-N Synonym: allyl bromide,3-bromopropene,1-propene, 3-bromo,3-bromopropylene,3-bromo-1-propene,bromallylene,2-propenyl bromide,1-bromo-2-propene,propene, 3-bromo,allylbromide PubChem CID: 7841 IUPAC Name: 3-bromoprop-1-ene SMILES: C=CCBr
| PubChem CID | 7841 |
|---|---|
| CAS | 106-95-6 |
| Molecular Weight (g/mol) | 120.98 |
| MDL Number | MFCD00000244 |
| SMILES | C=CCBr |
| Synonym | allyl bromide,3-bromopropene,1-propene, 3-bromo,3-bromopropylene,3-bromo-1-propene,bromallylene,2-propenyl bromide,1-bromo-2-propene,propene, 3-bromo,allylbromide |
| IUPAC Name | 3-bromoprop-1-ene |
| InChI Key | BHELZAPQIKSEDF-UHFFFAOYSA-N |
| Molecular Formula | C3H5Br |
Iodoacetonitrile, 95%
CAS: 624-75-9 Molecular Formula: C2H2IN Molecular Weight (g/mol): 166.95 MDL Number: MFCD00001886 InChI Key: VODKOOOHHCAWFR-UHFFFAOYSA-N Synonym: iodoacetonitrile,acetonitrile, iodo,iodo-acetonitrile,2-iodoethanenitrile,2-iodo acetonitrile,2-iodoaceto-nitrile,2-iodanylethanenitrile,pubchem12543,acmc-1ba3n PubChem CID: 69356 IUPAC Name: 2-iodoacetonitrile SMILES: C(C#N)I
| PubChem CID | 69356 |
|---|---|
| CAS | 624-75-9 |
| Molecular Weight (g/mol) | 166.95 |
| MDL Number | MFCD00001886 |
| SMILES | C(C#N)I |
| Synonym | iodoacetonitrile,acetonitrile, iodo,iodo-acetonitrile,2-iodoethanenitrile,2-iodo acetonitrile,2-iodoaceto-nitrile,2-iodanylethanenitrile,pubchem12543,acmc-1ba3n |
| IUPAC Name | 2-iodoacetonitrile |
| InChI Key | VODKOOOHHCAWFR-UHFFFAOYSA-N |
| Molecular Formula | C2H2IN |
Cyclobutyl bromide, 97%, pure
CAS: 4399-47-7 Molecular Formula: C4H7Br Molecular Weight (g/mol): 135.01 MDL Number: MFCD00001317 InChI Key: KXVUSQIDCZRUKF-UHFFFAOYSA-N Synonym: cyclobutyl bromide,cyclobutane, bromo,cyclobutylbromid,cyclobutylbromide,bromo cyclobutane,bromo-cyclobutane,bromocyclobutane,acmc-209jw1,ksc235o4p,inchi=1/c4h7br/c5-4-2-1-3-4/h4h,1-3h PubChem CID: 78110 IUPAC Name: bromocyclobutane SMILES: C1CC(C1)Br
| PubChem CID | 78110 |
|---|---|
| CAS | 4399-47-7 |
| Molecular Weight (g/mol) | 135.01 |
| MDL Number | MFCD00001317 |
| SMILES | C1CC(C1)Br |
| Synonym | cyclobutyl bromide,cyclobutane, bromo,cyclobutylbromid,cyclobutylbromide,bromo cyclobutane,bromo-cyclobutane,bromocyclobutane,acmc-209jw1,ksc235o4p,inchi=1/c4h7br/c5-4-2-1-3-4/h4h,1-3h |
| IUPAC Name | bromocyclobutane |
| InChI Key | KXVUSQIDCZRUKF-UHFFFAOYSA-N |
| Molecular Formula | C4H7Br |
Heptafluorobutyric acid, 99%
CAS: 375-22-4 Molecular Formula: C4HF7O2 Molecular Weight (g/mol): 214.04 MDL Number: MFCD00004171 InChI Key: YPJUNDFVDDCYIH-UHFFFAOYSA-N Synonym: heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech PubChem CID: 9777 ChEBI: CHEBI:39426 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoic acid SMILES: C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O
| PubChem CID | 9777 |
|---|---|
| CAS | 375-22-4 |
| Molecular Weight (g/mol) | 214.04 |
| ChEBI | CHEBI:39426 |
| MDL Number | MFCD00004171 |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)O |
| Synonym | heptafluorobutyric acid,perfluorobutyric acid,heptafluorobutanoic acid,perfluorobutanoic acid,butanoic acid, heptafluoro,heptafluoro-1-butanoic acid,perfluoropropanecarboxylic acid,butyric acid, heptafluoro,kyselina heptafluormaselna,kyselina heptafluormaselna czech |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoic acid |
| InChI Key | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Molecular Formula | C4HF7O2 |
| Boiling Point | 41.0°C to 43.0°C |
|---|---|
| Molecular Weight (g/mol) | 141.94 |
| Chemical Name or Material | Iodomethane |
| Merck Index | 15, 6159 |
| Density | 0.9330g/mL |
| Name Note | 2M Solution in tert-Butyl Ether |
| CAS | 74-88-4 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. Keep away from heat/spark |
| MDL Number | MFCD00001073 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Toxic if inhaled. Causes skin irritation. May cause respiratory irritation. Suspected of causing cancer. Highly flammable liquid and vapor. |
| Flash Point | −18°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| EINECS Number | 200-819-5 |
| Formula Weight | 141.94 |
| Specific Gravity | 0.933 |
3-Bromo-2-methylpropene, 97%
CAS: 1458-98-6 Molecular Formula: C4H7Br Molecular Weight (g/mol): 135.00 MDL Number: MFCD00134155 InChI Key: USEGQJLHQSTGHW-UHFFFAOYSA-N Synonym: 3-bromo-2-methylpropene,3-bromo-2-methyl-1-propene,methallyl bromide,2-bromomethyl prop-1-ene,2-methylallyl bromide,1-propene, 3-bromo-2-methyl,3-bromo-2-methyl-prop-1-ene,3-bromo-2-methylpropene, stabilized with hydroquinone,methallylbromide,methylallyl bromide PubChem CID: 357785 IUPAC Name: 3-bromo-2-methylprop-1-ene SMILES: CC(=C)CBr
| PubChem CID | 357785 |
|---|---|
| CAS | 1458-98-6 |
| Molecular Weight (g/mol) | 135.00 |
| MDL Number | MFCD00134155 |
| SMILES | CC(=C)CBr |
| Synonym | 3-bromo-2-methylpropene,3-bromo-2-methyl-1-propene,methallyl bromide,2-bromomethyl prop-1-ene,2-methylallyl bromide,1-propene, 3-bromo-2-methyl,3-bromo-2-methyl-prop-1-ene,3-bromo-2-methylpropene, stabilized with hydroquinone,methallylbromide,methylallyl bromide |
| IUPAC Name | 3-bromo-2-methylprop-1-ene |
| InChI Key | USEGQJLHQSTGHW-UHFFFAOYSA-N |
| Molecular Formula | C4H7Br |
1-Bromobutane, 99%
CAS: 109-65-9 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000260 InChI Key: MPPPKRYCTPRNTB-UHFFFAOYSA-N Synonym: butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 PubChem CID: 8002 IUPAC Name: 1-bromobutane SMILES: CCCCBr
| PubChem CID | 8002 |
|---|---|
| CAS | 109-65-9 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000260 |
| SMILES | CCCCBr |
| Synonym | butyl bromide,n-butyl bromide,bromobutane,butane, 1-bromo,1-butyl bromide,butane, bromo,n-butylbromide,1-bromo-butane,unii-sav6y78u3d,ccris 831 |
| IUPAC Name | 1-bromobutane |
| InChI Key | MPPPKRYCTPRNTB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
Carbon tetrabromide, 98%
CAS: 558-13-4 Molecular Formula: CBr4 Molecular Weight (g/mol): 331.64 MDL Number: MFCD00000117 InChI Key: HJUGFYREWKUQJT-UHFFFAOYSA-N Synonym: carbon tetrabromide,methane, tetrabromo,carbon bromide,methane tetrabromide,bromid uhlicity,carbontetrabromide,methane, tetrabromide,tetrabrommethan,bromid uhlicity czech PubChem CID: 11205 ChEBI: CHEBI:47875 IUPAC Name: tetrabromomethane SMILES: C(Br)(Br)(Br)Br
| PubChem CID | 11205 |
|---|---|
| CAS | 558-13-4 |
| Molecular Weight (g/mol) | 331.64 |
| ChEBI | CHEBI:47875 |
| MDL Number | MFCD00000117 |
| SMILES | C(Br)(Br)(Br)Br |
| Synonym | carbon tetrabromide,methane, tetrabromo,carbon bromide,methane tetrabromide,bromid uhlicity,carbontetrabromide,methane, tetrabromide,tetrabrommethan,bromid uhlicity czech |
| IUPAC Name | tetrabromomethane |
| InChI Key | HJUGFYREWKUQJT-UHFFFAOYSA-N |
| Molecular Formula | CBr4 |
Bromoacetonitrile, 97%
CAS: 590-17-0 Molecular Formula: C2H2BrN Molecular Weight (g/mol): 119.95 MDL Number: MFCD00001884 InChI Key: REXUYBKPWIPONM-UHFFFAOYSA-N Synonym: bromoacetonitrile,acetonitrile, bromo,bromomethyl cyanide,cyanomethyl bromide,ccris 6213,2-bromoethanenitrile,unii-07k08j16vk,bromacetonitrile,bromoacetonitile,bromo acetonitrile PubChem CID: 11534 IUPAC Name: 2-bromoacetonitrile SMILES: BrCC#N
| PubChem CID | 11534 |
|---|---|
| CAS | 590-17-0 |
| Molecular Weight (g/mol) | 119.95 |
| MDL Number | MFCD00001884 |
| SMILES | BrCC#N |
| Synonym | bromoacetonitrile,acetonitrile, bromo,bromomethyl cyanide,cyanomethyl bromide,ccris 6213,2-bromoethanenitrile,unii-07k08j16vk,bromacetonitrile,bromoacetonitile,bromo acetonitrile |
| IUPAC Name | 2-bromoacetonitrile |
| InChI Key | REXUYBKPWIPONM-UHFFFAOYSA-N |
| Molecular Formula | C2H2BrN |
3-Bromocyclohexene, 95%
CAS: 1521-51-3 Molecular Formula: C6H9Br Molecular Weight (g/mol): 161.04 MDL Number: MFCD00013775 InChI Key: AJKDUJRRWLQXHM-UHFFFAOYSA-N Synonym: 3-bromocyclohex-1-ene,cyclohexene, 3-bromo,1-bromo-2-cyclohexene,3-bromo-1-cyclohexene,1,2,3,4-tetrahydrobromobenzene,3-bromo-cyclohexene,2-cyclohexenyl bromide,2-cyclohexen-1-yl bromide,3-bromo cyclohexene,3-bromanylcyclohexene PubChem CID: 137057 IUPAC Name: 3-bromocyclohexene SMILES: C1CC=CC(C1)Br
| PubChem CID | 137057 |
|---|---|
| CAS | 1521-51-3 |
| Molecular Weight (g/mol) | 161.04 |
| MDL Number | MFCD00013775 |
| SMILES | C1CC=CC(C1)Br |
| Synonym | 3-bromocyclohex-1-ene,cyclohexene, 3-bromo,1-bromo-2-cyclohexene,3-bromo-1-cyclohexene,1,2,3,4-tetrahydrobromobenzene,3-bromo-cyclohexene,2-cyclohexenyl bromide,2-cyclohexen-1-yl bromide,3-bromo cyclohexene,3-bromanylcyclohexene |
| IUPAC Name | 3-bromocyclohexene |
| InChI Key | AJKDUJRRWLQXHM-UHFFFAOYSA-N |
| Molecular Formula | C6H9Br |
Bromotrichloromethane, 99%
CAS: 75-62-7 Molecular Formula: CBrCl3 Molecular Weight (g/mol): 198.27 MDL Number: MFCD00000783 InChI Key: XNNQFQFUQLJSQT-UHFFFAOYSA-N Synonym: methane, bromotrichloro,trichlorobromomethane,bromo trichloro methane,carbon bromotrichloride,monobromotrichloromethane,carbon trichlorobromide,trichloromethyl bromide,caswell no. 118,unii-ikj30qxm63,ccl3br PubChem CID: 6383 IUPAC Name: bromo(trichloro)methane SMILES: C(Cl)(Cl)(Cl)Br
| PubChem CID | 6383 |
|---|---|
| CAS | 75-62-7 |
| Molecular Weight (g/mol) | 198.27 |
| MDL Number | MFCD00000783 |
| SMILES | C(Cl)(Cl)(Cl)Br |
| Synonym | methane, bromotrichloro,trichlorobromomethane,bromo trichloro methane,carbon bromotrichloride,monobromotrichloromethane,carbon trichlorobromide,trichloromethyl bromide,caswell no. 118,unii-ikj30qxm63,ccl3br |
| IUPAC Name | bromo(trichloro)methane |
| InChI Key | XNNQFQFUQLJSQT-UHFFFAOYSA-N |
| Molecular Formula | CBrCl3 |