Learn More
Pyronin Y, pure, high purity biological stain, ACROS Organics™
Brand: Acros Organics 200100250
Additional Details : CAS Number : 92-32-0 Weight : 0.02500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 92-32-0 | |
| 302.802 | |
| INCIMLINXXICKS-UHFFFAOYSA-M | |
| 7085 | |
| [6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;chloride |
| C17H19ClN2O | |
| MFCD00011725 | |
| C.I. 45005, Pyronin G | |
| CHEBI:87347 | |
| CN(C)C1=CC2=C(C=C1)C=C3C=CC(=[N+](C)C)C=C3O2.[Cl-] |
Specifications
| PyroninY | |
| 92-32-0 | |
| 50% min. | |
| MFCD00011725 | |
| 15, 8119 | |
| INCIMLINXXICKS-UHFFFAOYSA-M | |
| CN(C)C1=CC2=C(C=C1)C=C3C=CC(=[N+](C)C)C=C3O2.[Cl-] | |
| 302.802 | |
| 7085 | |
| 302.79 | |
| Pure | |
| Green |
| Pure | |
| 1.23 to 1.7 | |
| C17H19ClN2O | |
| 18, V,10, 181 | |
| C.I. 45005, Pyronin G | |
| Authentic | |
| [6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;chloride | |
| 546 to 551nm (in 50% ethanol) | |
| CHEBI:87347 | |
| Crystalline Powder | |
| Glass bottle | |
| 25g |
Safety and Handling
- Pyronin Y
Signal Word
- Warning
Hazard Category
- Germ cell mutagenicity Category 2
Hazard Statement
- H341-Suspected of causing genetic defects.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.