Learn More
Nafion™ N-117 membrane, 0.180mm thick, ≥0.90 meq/g exchange capacity, Alfa Aesar™
Widely used for proton exchange membrane (PEM) fuel cells and water electrolyzers. It is popular for separators in electrochemical cells requiring high ionic conductivity such as fuel cells and water electrolyzers.
Brand: Alfa Aesar 042180.VA
Additional Details : CAS Number : 31175-20-9 Weight : 0.01000kg
| Quantity | 15 x 15cm |
|---|
Chemical Identifiers
| 31175-20-9 | |
| 544.135 | |
| FOYUGSIADQEOEK-UHFFFAOYSA-N | |
| 61889 | |
| C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)O)(F)F)F)(F)F)F.C(=C(F)F)(F)F |
| C9HF17O5S | |
| MFCD00132790 | |
| nafion, nafion nr 50 beads 10-35 mesh, perfluoro 2-2-sulfonylethoxy propyl vinyl ether-tetrafluoroethylene copolymer, tetrafluoroethylene-perfluoro 2-2-sulfonylethoxy propyl vinyl ether copolymer, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoroethanesulfonyl fluoride-tetrafl, ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-1,2,2-trifluoro-1-trifluoromethyl-2-1,2,2-trifluorovinyl oxy ethoxy-, pol, ethanesulfonic acid, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoro-, polymer, nafion n-324 membrane, 0.15mm 0.006in thick, teflon fabric reinforced, nafion nre-212 membrane, 0.05mm thick, >=0.92 meq/g exchange capacity, nafion d-520 dispersion w/w in water and 1-propanol, >=1.00 meq/g exchange capacity | |
| 1,1,2,2-tetrafluoroethene;1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonic acid |
Specifications
| Nafion™ N-117 membrane | |
| Shrink-wrapped | |
| 15 x 15cm | |
| C9HF17O5S | |
| nafion, nafion nr 50 beads 10-35 mesh, perfluoro 2-2-sulfonylethoxy propyl vinyl ether-tetrafluoroethylene copolymer, tetrafluoroethylene-perfluoro 2-2-sulfonylethoxy propyl vinyl ether copolymer, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoroethanesulfonyl fluoride-tetrafl, ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-1,2,2-trifluoro-1-trifluoromethyl-2-1,2,2-trifluorovinyl oxy ethoxy-, pol, ethanesulfonic acid, 2-1-difluoro trifluoroethenyl oxy methyl-1,2,2,2-tetrafluoroethoxy-1,1,2,2-tetrafluoro-, polymer, nafion n-324 membrane, 0.15mm 0.006in thick, teflon fabric reinforced, nafion nre-212 membrane, 0.05mm thick, >=0.92 meq/g exchange capacity, nafion d-520 dispersion w/w in water and 1-propanol, >=1.00 meq/g exchange capacity | |
| FOYUGSIADQEOEK-UHFFFAOYSA-N | |
| 1,1,2,2-tetrafluoroethene;1,1,2,2-tetrafluoro-2-[1,1,1,2,3,3-hexafluoro-3-(1,2,2-trifluoroethenoxy)propan-2-yl]oxyethanesulfonic acid | |
| 61889 |
| 1.98 | |
| Hygroscopic | |
| 31175-20-9 | |
| MFCD00132790 | |
| Insoluble in water. | |
| C(=C(F)F)(OC(C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)O)(F)F)F)(F)F)F.C(=C(F)F)(F)F | |
| 544.135 |