Learn More
Hexaketocyclohexane octahydrate, 97%, ACROS Organics™
Brand: Acros Organics 156280100
Additional Details : CAS Number : 7255-28-9 Weight : 0.01000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 10g |
Chemical Identifiers
| 7255-28-9 | |
| 312.17 | |
| PKRGYJHUXHCUCN-UHFFFAOYSA-N | |
| 68240 | |
| C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
| C6O6·8H2O | |
| MFCD00149074 | |
| cyclohexanehexone, triquinoyl, cyclohexane-1,2,3,4,5,6-hexaone, cyclohexanehexaone, hexaketocyclohexane, unii-7zr8062lfd, trichinoyl, hexaoxocyclohexane, hexaoxocyclohexaneoctahydrate, cyclohexane-hexone, octahydrate | |
| cyclohexane-1,2,3,4,5,6-hexone |
Specifications
| Hexaketocyclohexane octahydrate | |
| Glass bottle | |
| 90.0°C to 93.0°C | |
| 97% | |
| 97% | |
| MFCD00149074 | |
| cyclohexanehexone, triquinoyl, cyclohexane-1,2,3,4,5,6-hexaone, cyclohexanehexaone, hexaketocyclohexane, unii-7zr8062lfd, trichinoyl, hexaoxocyclohexane, hexaoxocyclohexaneoctahydrate, cyclohexane-hexone, octahydrate | |
| C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O | |
| 312.17 | |
| 312.17 | |
| 97% |
| Authentic | |
| Beige to Brown-Gray | |
| 10g | |
| 7255-28-9 | |
| C6O6·8H2O | |
| 07, 907 | |
| PKRGYJHUXHCUCN-UHFFFAOYSA-N | |
| cyclohexane-1,2,3,4,5,6-hexone | |
| 68240 | |
| Powder |
Safety and Handling
- Hexaketocyclohexane octahydrate
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
Hazard Statement
- H332-Harmful if inhaled.
- H312-Harmful in contact with skin.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P304+P340-IF INHALED: Remove person to fresh air and keep comfortable for breathing.