Learn More
Diethyl 4-aminobenzylphosphonate, 98%, Acros Organics
Brand: Acros Organics 114010050
Additional Details : CAS Number : 20074-79-7 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Description
for C-C Bond Formation (Olefination)Chemical Identifiers
| 20074-79-7 | |
| 243.24 | |
| ZVAYUUUQOCPZCZ-UHFFFAOYSA-N | |
| 88358 | |
| CCOP(=O)(CC1=CC=C(C=C1)N)OCC |
| C11H18NO3P | |
| MFCD00007913 | |
| diethyl 4-aminobenzylphosphonate, diethyl p-aminobenzylphosphonate, 4-diethoxyphosphorylmethyl aniline, p-aminobenzylphosphonic acid diethyl ester, diethyl p-aminobenzyl phosphonate, phosphonic acid, p-aminobenzyl-, diethyl ester, diethyl 4-aminophenyl methylphosphonate, phosphonic acid, 4-aminophenyl methyl-, diethyl ester, timtec-bb sbb000830 | |
| 4-(diethoxyphosphorylmethyl)aniline |
Specifications
| Diethyl 4-aminobenzylphosphonate | |
| Glass bottle | |
| 90°C to 94°C | |
| 98% | |
| 98% | |
| (C2H5O)2P(O)CH2C6H4NH2 | |
| diethyl 4-aminobenzylphosphonate, diethyl p-aminobenzylphosphonate, 4-diethoxyphosphorylmethyl aniline, p-aminobenzylphosphonic acid diethyl ester, diethyl p-aminobenzyl phosphonate, phosphonic acid, p-aminobenzyl-, diethyl ester, diethyl 4-aminophenyl methylphosphonate, phosphonic acid, 4-aminophenyl methyl-, diethyl ester, timtec-bb sbb000830 | |
| CCOP(=O)(CC1=CC=C(C=C1)N)OCC | |
| 243.24 | |
| 243.24 | |
| 98% |
| Authentic | |
| Beige to Brown | |
| 5g | |
| 20074-79-7 | |
| C11H18NO3P | |
| MFCD00007913 | |
| ZVAYUUUQOCPZCZ-UHFFFAOYSA-N | |
| 4-(diethoxyphosphorylmethyl)aniline | |
| 88358 | |
| Crystals or Crystalline Powder |