Learn More
Citric Acid, Anhydrous, 99%, Pure, ACROS Organics™
Brand: Acros Organics 110450010
Additional Details : CAS Number : 77-92-9 Weight : 1.03024kg
| Packaging | Plastic Bottle |
|---|---|
| Quantity | 1kg |
Chemical Identifiers
| 77-92-9 | |
| 192.123 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 311 | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid |
| C6H8O7 | |
| MFCD00011669 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| CHEBI:30769 | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Specifications
| Citric acid | |
| 77-92-9 | |
| C6H8O7 | |
| MFCD00011669 | |
| 15, 2325 | |
| KRKNYBCHXYNGOX-UHFFFAOYSA-N | |
| 2-hydroxypropane-1,2,3-tricarboxylic acid | |
| 311 | |
| 192.13 | |
| 99% | |
| Authentic | |
| Solubility in water: 750g/L (20°C). Other solubilities: soluble in alcohol and ether, badly soluble in diethyl ether, insoluble in benzene and chloroform | |
| White | |
| 100°C |
| Anhydrous | |
| 99% | |
| HO2CCH2C(OH)(CO2H)CH2CO2H | |
| 03, 556 | |
| citric acid, citric acid, anhydrous, citro, anhydrous citric acid, citrate, aciletten, citretten, chemfill, hydrocerol a, 1,2,3-propanetricarboxylic acid, 2-hydroxy | |
| C(C(=O)O)C(CC(=O)O)(C(=O)O)O | |
| 192.123 | |
| CHEBI:30769 | |
| Crystals | |
| Pure | |
| Plastic Bottle | |
| 153.0°C | |
| 1kg |
Safety and Handling
- Citric acid anhydrous
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
Hazard Statement
- H319-Causes serious eye irritation.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P264-Wash thoroughly after handling.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
- P337+P313-If eye irritation persists: Get medical advice/attention.