Learn More
Bis(2-ethylhexyl) phosphate, 95%, Alfa Aesar™
Extraction of metals
Brand: Alfa Aesar 017723.22
Additional Details : CAS Number : 298-07-7 Weight : 0.10000kg Transport : UN number : 1902 Chem class : 8 Pack group : III
| Quantity | 100g |
|---|
Chemical Identifiers
| 298-07-7 | |
| 322.426 | |
| SEGLCEQVOFDUPX-UHFFFAOYSA-N | |
| 9275 | |
| CCCCC(CC)COP(=O)(O)OCC(CC)CCCC |
| C16H35O4P | |
| MFCD00009492 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| bis(2-ethylhexyl) hydrogen phosphate |
Specifications
| Bis(2-ethylhexyl) phosphate | |
| 171°C (340°F) | |
| 48°C (12mmHg) | |
| -50°C | |
| 2 to 3 | |
| 95% | |
| MFCD00009492 | |
| bis 2-ethylhexyl hydrogen phosphate, bis 2-ethylhexyl phosphate, hdehp, di 2-ethylhexyl phosphate, dehpa extractant, di 2-ethylhexyl phosphoric acid, escaid 100, d 2ehpa, bis 2-ethylhexyl phosphoric acid | |
| SEGLCEQVOFDUPX-UHFFFAOYSA-N | |
| bis(2-ethylhexyl) hydrogen phosphate | |
| 9275 | |
| Liquid |
| 0.965 g/mL | |
| 1.442 | |
| Colorless | |
| 100g | |
| 298-07-7 | |
| C16H35O4P | |
| UN1902 | |
| Slightly miscible with water. | |
| CCCCC(CC)COP(=O)(O)OCC(CC)CCCC | |
| 322.426 | |
| 322.43 | |
| 95% |