Learn More
Alfa Aesar™ Benzyl benzoate, 99+%
Brand: Alfa Aesar™ L03258.0E
Additional Details : CAS Number : 120-51-4 Weight : 2.50000kg Transport : UN number : 3082 Chem class : 9 Pack group : III
| Quantity | 2500g |
|---|
Description
SolubilityMiscible with ethanol, alcohol, chloroform, ether, oils.
Notes
Incompatible with oxidizing agents. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances.
Chemical Identifiers
| 120-51-4 | |
| 212.248 | |
| SESFRYSPDFLNCH-UHFFFAOYSA-N | |
| 2345 | |
| benzyl benzoate |
| C14H12O2 | |
| MFCD00003075 | |
| ascabiol, benylate, novoscabin, benzoic acid, phenylmethyl ester, scabitox, scobenol, ascabin, benzyl phenylformate, benzoic acid, benzyl ester, phenylmethyl benzoate | |
| CHEBI:41237 | |
| C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2 |
Specifications
| Benzyl benzoate | |
| 147°C (296°F) | |
| 323°C to 324°C | |
| 2500g | |
| C14H12O2 | |
| MFCD00003075 | |
| 2049280 | |
| ascabiol, benylate, novoscabin, benzoic acid, phenylmethyl ester, scabitox, scobenol, ascabin, benzyl phenylformate, benzoic acid, benzyl ester, phenylmethyl benzoate | |
| SESFRYSPDFLNCH-UHFFFAOYSA-N | |
| benzyl benzoate | |
| 2345 | |
| 212.25 |
| 1.112 | |
| 1.568 | |
| 18°C to 20°C | |
| 120-51-4 | |
| C6H5CO2CH2C6H5 | |
| UN3082 | |
| 14,1127 | |
| Miscible with ethanol,alcohol,chloroform,ether,oils. | |
| C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2 | |
| 212.248 | |
| CHEBI:41237 | |
| ≥99% |