Learn More
4-Nitroanisole, 99+%, ACROS Organics™
Brand: Acros Organics 147022500
Additional Details : CAS Number : 100-17-4 Weight : 0.30000kg Transport : UN number : 3458 Chem class : 6.1 Pack group : III
| Packaging | Glass bottle |
|---|---|
| Quantity | 250g |
Chemical Identifiers
| 100-17-4 | |
| 153.14 | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 7485 | |
| 1-methoxy-4-nitrobenzene |
| C7H7NO3 | |
| MFCD00007327 | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| CHEBI:1911 | |
| COC1=CC=C(C=C1)[N+](=O)[O-] |
Specifications
| 4-Nitroanisole | |
| 130°C | |
| Glass bottle | |
| 260.0°C | |
| 51.0°C to 53.0°C | |
| 99+% | |
| 99.0 | |
| 99% min. (GC) | |
| O2NC6H4OCH3 | |
| 06, 230 | |
| 4-nitroanisole, p-nitroanisole, 4-methoxynitrobenzene, p-methoxynitrobenzene, benzene, 1-methoxy-4-nitro, nitroanisole, p-nitroanisol, anisole, p-nitro, 4-nitrophenyl methyl ether, unii-g989z7wolh | |
| BNUHAJGCKIQFGE-UHFFFAOYSA-N | |
| 1-methoxy-4-nitrobenzene | |
| 7485 | |
| 153.14 | |
| 99+% |
| 1.2300g/mL | |
| Authentic | |
| 1.23 | |
| Brown to Green | |
| 250g | |
| 100-17-4 | |
| 100.0 | |
| C7H7NO3 | |
| MFCD00007327 | |
| 15, 6671 | |
| Solubility in water: 0.468g/L (20°C). Other solubilities: soluble in alcohol and ether | |
| COC1=CC=C(C=C1)[N+](=O)[O-] | |
| 153.14 | |
| CHEBI:1911 | |
| Crystals |
Safety and Handling
- 4-Nitroanisole
Signal Word
- Warning
Hazard Category
- Germ cell mutagenicity Category 2
Hazard Statement
- H341-Suspected of causing genetic defects.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.