Learn More
Alfa Aesar™ 3,3',4,4'-Benzophenonetetracarboxylic dianhydride, 97+%
Brand: Alfa Aesar™ A16529.A4
Additional Details : CAS Number : 2421-28-5 Weight : 2.50000kg
| Quantity | 2.5kg |
|---|
Description
ApplicationsBTDA polymer fine free-flowing powder suitable for general purposes. BTDA Microfine Micronized powder facilitates mixing in epoxy resins. BTDA ultrapure high-purity, high-assay powder for critical polyimide synthesis.
Solubility
Soluble in DMF (0.1 g/mL). Reacts with water.
Notes
Moisture Sensitive. Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents.
Chemical Identifiers
| 2421-28-5 | |
| 322.228 | |
| VQVIHDPBMFABCQ-UHFFFAOYSA-N | |
| 75498 | |
| C1=CC2=C(C=C1C(=O)C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
| C17H6O7 | |
| MFCD00005923 | |
| 3,3',4,4'-benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic acid dianhydride, 1,3-isobenzofurandione, 5,5'-carbonylbis, 4,4'-carbonylbis phthalic anhydride, 4,4'-carbonyldiphthalic anhydride, 4,4'-diphthalic anhydride ketone, benzophenonetetracarboxylic anhydride, phthalic anhydride, 4,4'-carbonyldi, unii-y61gva8097 | |
| 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione |
Specifications
| 3,3',4,4'-Benzophenonetetracarboxylic dianhydride | |
| 324°C (615°F) | |
| 320°C (5mmHg) | |
| 2.5kg | |
| C17H6O7 | |
| 761777 | |
| Soluble in DMF (0.1g/mL). Reacts with water. | |
| C1=CC2=C(C=C1C(=O)C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O | |
| 322.228 | |
| 322.23 |
| 1.57 | |
| Moisture sensitive | |
| 220°C to 226°C | |
| 2421-28-5 | |
| MFCD00005923 | |
| 3,3',4,4'-benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic acid dianhydride, 1,3-isobenzofurandione, 5,5'-carbonylbis, 4,4'-carbonylbis phthalic anhydride, 4,4'-carbonyldiphthalic anhydride, 4,4'-diphthalic anhydride ketone, benzophenonetetracarboxylic anhydride, phthalic anhydride, 4,4'-carbonyldi, unii-y61gva8097 | |
| VQVIHDPBMFABCQ-UHFFFAOYSA-N | |
| 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione | |
| 75498 | |
| ≥97% |