Learn More
Alfa Aesar™ 1-(Heptafluorobutyryl)imidazole, 98+%
Brand: Alfa Aesar™ L00221.06
Additional Details : CAS Number : 32477-35-3 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
Applications1-(Heptafluorobutyryl)imidazole is used in gas chromatography for the determination of various pharmaceutical compounds like retronecine in biological matrixes. It acts as a reagent for derivatize amine-groups. It plays an essential role to reduce GC column degradation due to its non-acidic property. It is an acylating agent, which converts thermally unstable compounds to its more volatile derivative and then made suitable for GC analysis.
Solubility
Miscible with chloroform and methanol.
Notes
Hygroscopic and air sensitive. Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Incompatible with strong oxidizing agents.
Chemical Identifiers
| 32477-35-3 | |
| 264.103 | |
| MSYHGYDAVLDKCE-UHFFFAOYSA-N | |
| 94431 | |
| C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F |
| C7H3F7N2O | |
| MFCD00014503 | |
| n-heptafluorobutyrylimidazole, 1-heptafluorobutyryl imidazole, heptafluorobutyrylimidazole, n-heptafluorobutyryl imidazole, hfbi, 1-perfluorobutyryl imidazole, 2,2,3,3,4,4,4-heptafluoro-1-1h-imidazol-1-yl butan-1-one, 1-2,2,3,3,4,4,4-heptafluoro-1-oxobutyl-1h-imidazole, 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-yl butan-1-one, 1h-imidazole, 1-2,2,3,3,4,4,4-heptafluoro-1-oxobutyl | |
| 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one |
Specifications
| 1-(Heptafluorobutyryl)imidazole | |
| 77°C (170°F) | |
| Moisture sensitive | |
| 10°C to 13°C | |
| 32477-35-3 | |
| MFCD00014503 | |
| n-heptafluorobutyrylimidazole, 1-heptafluorobutyryl imidazole, heptafluorobutyrylimidazole, n-heptafluorobutyryl imidazole, hfbi, 1-perfluorobutyryl imidazole, 2,2,3,3,4,4,4-heptafluoro-1-1h-imidazol-1-yl butan-1-one, 1-2,2,3,3,4,4,4-heptafluoro-1-oxobutyl-1h-imidazole, 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-yl butan-1-one, 1h-imidazole, 1-2,2,3,3,4,4,4-heptafluoro-1-oxobutyl | |
| MSYHGYDAVLDKCE-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,4-heptafluoro-1-imidazol-1-ylbutan-1-one | |
| 94431 | |
| ≥98% |
| 1.49 | |
| 1.385 | |
| 160°C to 162°C | |
| 5g | |
| C7H3F7N2O | |
| 4488026 | |
| Miscible with chloroform and methanol. | |
| C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F | |
| 264.103 | |
| 264.1 |