Learn More
Alfa Aesar™ 1,3-Bis(chloromethyl)tetramethyldisiloxane, 97%
Brand: Alfa Aesar™ L04436.09
Additional Details : CAS Number : 2362-10-9 Weight : 0.01000kg
| Quantity | 10g |
|---|
Description
Applications1,3-Bis(chloromethyl)tetramethyldisiloxane is a useful bifunctional silylating agent.
Solubility
Not miscible or difficult to mix with water.
Notes
Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. Incompatible with oxidizing agents.
Chemical Identifiers
| 2362-10-9 | |
| 231.26 | |
| NBGGEWGFZUDQKZ-UHFFFAOYSA-N | |
| 75385 | |
| C[Si](C)(CCl)O[Si](C)(C)CCl |
| C6H16Cl2OSi2 | |
| MFCD00000877 | |
| 1,3-bis chloromethyl-1,1,3,3-tetramethyldisiloxane, 1,3-bis chloromethyl tetramethyldisiloxane, bis chloromethyl tetramethyldisiloxane, disiloxane, 1,3-bis chloromethyl-1,1,3,3-tetramethyl, tetramethylbis chloromethyl disiloxane, tetramethyl-1,3-bis chloromethyl disiloxane, chloromethyl chloromethyl dimethylsilyl oxy dimethylsilane, disiloxane,3-bis chloromethyl-1,1,3,3-tetramethyl, pubchem13666, acmc-2097an | |
| chloromethyl-[chloromethyl(dimethyl)silyl]oxy-dimethylsilane |
Specifications
| 1,3-Bis(chloromethyl)tetramethyldisiloxane | |
| C6H16Cl2OSi2 | |
| 506631 | |
| Not miscible or difficult to mix with water. | |
| C[Si](C)(CCl)O[Si](C)(C)CCl | |
| 231.26 | |
| 231.27 | |
| 1.05 | |
| 92°C to 93°C (20mmHg) | |
| 73°C (163°F) |
| 2362-10-9 | |
| MFCD00000877 | |
| 1,3-bis chloromethyl-1,1,3,3-tetramethyldisiloxane, 1,3-bis chloromethyl tetramethyldisiloxane, bis chloromethyl tetramethyldisiloxane, disiloxane, 1,3-bis chloromethyl-1,1,3,3-tetramethyl, tetramethylbis chloromethyl disiloxane, tetramethyl-1,3-bis chloromethyl disiloxane, chloromethyl chloromethyl dimethylsilyl oxy dimethylsilane, disiloxane,3-bis chloromethyl-1,1,3,3-tetramethyl, pubchem13666, acmc-2097an | |
| NBGGEWGFZUDQKZ-UHFFFAOYSA-N | |
| chloromethyl-[chloromethyl(dimethyl)silyl]oxy-dimethylsilane | |
| 75385 | |
| 97% | |
| 1.44 | |
| 10g |