Filtrerede søgeresultater
| CAS | 111-90-0 |
|---|
Citronsyre, 99,5 til 100,5% (baseret på vandfrit stof), Honeywell Fluka™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
CAS: 77-92-9 Molekylær formel: C6H8O7 Molekylvægt (g/mol): 192.12 MDL nummer: MFCD00011669 InChI nøgle: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC navn: 2-hydroxypropan-1,2,3-tricarboxylsyre SMIL: OC(=O)CC(O)(CC(O)=O)C(O)=O
| MDL nummer | MFCD00011669 |
|---|---|
| PubChem CID | 311 |
| Molekylvægt (g/mol) | 192.12 |
| CAS | 77-92-9 |
| ChEBI | CHEBI:30769 |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| SMIL | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| IUPAC navn | 2-hydroxypropan-1,2,3-tricarboxylsyre |
| InChI nøgle | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Molekylær formel | C6H8O7 |
Natriumbicarbonat, Honeywell Fluka™
CAS: 144-55-8 Molekylær formel: CHNaO3 Molekylvægt (g/mol): 84.01 MDL nummer: MFCD00003528 InChI nøgle: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMIL: [Na+].OC([O-])=O
| MDL nummer | MFCD00003528 |
|---|---|
| PubChem CID | 516892 |
| Molekylvægt (g/mol) | 84.01 |
| CAS | 144-55-8 |
| ChEBI | CHEBI:32139 |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| SMIL | [Na+].OC([O-])=O |
| InChI nøgle | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molekylær formel | CHNaO3 |
Natriumthiosulfatopløsning, 1M, Honeywell Fluka™
CAS: 7772-98-7 Molekylær formel: Na2O3S2 Molekylvægt (g/mol): 158.10 MDL nummer: MFCD00003499 InChI nøgle: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt PubChem CID: 24477 SMIL: [Na+].[Na+].[O-]S([S-])(=O)=O
| MDL nummer | MFCD00003499 |
|---|---|
| PubChem CID | 24477 |
| Molekylvægt (g/mol) | 158.10 |
| CAS | 7772-98-7 |
| Synonym | sodium thiosulfate,sodium thiosulphate,disodium thiosulfate,sodium thiosulfate anhydrous,hypo,sodiumthiosulfate,chlorine cure,chlorine control,declor-it,thiosulfuric acid, disodium salt |
| SMIL | [Na+].[Na+].[O-]S([S-])(=O)=O |
| InChI nøgle | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molekylær formel | Na2O3S2 |
Sodium Metabisulfite, puriss. pa ACS reagens, Honeywell Fluka™
CAS: 7681-57-4 Molekylær formel: Na2O5S2 Molekylvægt (g/mol): 190.09 MDL nummer: MFCD00167602 InChI nøgle: LDTLADDKFLAYJA-UHFFFAOYSA-L Synonym: sodium metabisulfite,sodium pyrosulfite,sodium disulfite,disodium pyrosulfite,sodium metabisulphite,disodium disulfite,disodium disulphite,fertisilo,disodium metabisulfite,natrii disulfis PubChem CID: 656671 IUPAC navn: dinatrium(sulfinatooxy)sulfinat SMIL: [Na+].[Na+].[O-]S(=O)OS([O-])=O
| MDL nummer | MFCD00167602 |
|---|---|
| PubChem CID | 656671 |
| Molekylvægt (g/mol) | 190.09 |
| CAS | 7681-57-4 |
| Synonym | sodium metabisulfite,sodium pyrosulfite,sodium disulfite,disodium pyrosulfite,sodium metabisulphite,disodium disulfite,disodium disulphite,fertisilo,disodium metabisulfite,natrii disulfis |
| SMIL | [Na+].[Na+].[O-]S(=O)OS([O-])=O |
| IUPAC navn | dinatrium(sulfinatooxy)sulfinat |
| InChI nøgle | LDTLADDKFLAYJA-UHFFFAOYSA-L |
| Molekylær formel | Na2O5S2 |
Natriumchlorid, Puriss. pa, ACS-reagens, Reag. ISO, Reag. Ph. Eur.,≥ 99,5 %, Honeywell Fluka™
CAS: 7647-14-5 Molekylær formel: ClNa Molekylvægt (g/mol): 58.44 MDL nummer: MFCD00003477 InChI nøgle: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMIL: [Na+].[Cl-]
| MDL nummer | MFCD00003477 |
|---|---|
| PubChem CID | 5234 |
| Molekylvægt (g/mol) | 58.44 |
| CAS | 7647-14-5 |
| ChEBI | CHEBI:26710 |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| SMIL | [Na+].[Cl-] |
| InChI nøgle | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molekylær formel | ClNa |
HYDRANAL™ -Vand Standard KF-Ovn, 150-160 °C, Honeywell Fluka™
Standard for Karl Fischer ovnkontrol (vandindhold∼ 5,0 %, nøjagtig værdi på analyserapport)
HYDRANAL™ - Coulomat CG, reagens til coulometrisk KF-titrering (katolytopløsning), Honeywell Fluka™
| Sundhedsfare 2 | P210-P280-P304 + P340 + P312-P305 + P351 + P338 + P310-P370 + P378-P403 + P235 |
|---|---|
| CAS | 7446-09-5 |
| FN nummer | UN1230 |
| Kemisk navn eller materiale | HYDRANAL™ - Coulomat AK |
|---|---|
| Emballage | Glasflaske |
| CAS min % | ≥20.0000% |
| Grad | Karl Fischer |
| Navn note | Reagent for coulometric KF titration in ketones (anolyte solution), preferred for cells with diaphragm |
| Anbefalet opbevaring | Rumtemp |
| Tæthed | 1.200 g/cm3 |
| CAS | 109-86-4 |
| DOT information | Transport Hazard Class: 3; Packing Group:3: III; Proper Shipping Name: Flammable liquids, toxic, n.o.s. |
| Holdbarhed | 1800 days from date of manufacture |
| Kogepunkt | 60°C |
| Flammepunkt | 32°C |
| FN nummer | UN1992 |
| CAS Max % | <5.0000% |
| CAS | 111-90-0 |
|---|
HYDRANAL™ - Medium K, Honeywell Fluka™
Medium til volumetrisk en-komponent Karl Fischer titrering i aldehyder og ketoner (methanolfri).
| FN nummer | UN1992 |
|---|
| Kemisk navn eller materiale | HYDRANAL™ - Coulomat AG-Oven |
|---|---|
| Emballage | Glasflaske |
| CAS min % | ≥20.0000% |
| Grad | Karl Fischer |
| Navn note | Reagent for coulometric KF titration with oven (anolyte solution), for cells with and without diaphragm |
| Anbefalet opbevaring | Rumtemp |
| Tæthed | 0.980 g/cm3 |
| CAS | 57-55-6 |
| DOT information | Transport Hazard Class: 3; Packing Group:3: II; Proper Shipping Name: Methanol Solution |
| Holdbarhed | 1800 days from date of manufacture |
| Kogepunkt | 64°C |
| Flammepunkt | 13°C |
| FN nummer | UN1230 |
| CAS Max % | <10.0000% |